Wiskunde · Book 3 · Bachelor jaar 1

University Mathematics — Year 1

University Mathematics — Year 1 · Bachelor jaar 1

8Polynomials

Polynomials are the algebraist’s favorite functions — except that they are not treated as functions here, but as formal expressions in an indeterminate XX, added and multiplied by the rules of a commutative ring. The theory runs strikingly parallel to Chapter 6: a Euclidean division, a gcd and Bézout relations, irreducible elements and a unique factorization. Throughout, KK denotes Q\Q, R\R or C\C.

8.1 The ring K[X]K[X]

Definition 8.1 (Polynomial, degree)

A polynomial with coefficients in KK is a formal sum

P=a0+a1X+a2X2++anXn=kakXk,P = a_0 + a_1 X + a_2 X^2 + \dots + a_n X^n = \sum_{k} a_k X^k,

with akKa_k \in K all zero from some index on. With the natural addition and the product

(iaiXi)(jbjXj)=k(i+j=kaibj)Xk,\Bigl(\sum_i a_i X^i\Bigr)\Bigl(\sum_j b_j X^j\Bigr) = \sum_k \Bigl(\sum_{i+j=k} a_i b_j\Bigr) X^k,

the set K[X]K[X] is a commutative ring. The degree degP\deg P of P0P \neq 0 is the largest nn with an0a_n \neq 0; ana_n is the leading coefficient (PP is monic when an=1a_n = 1), and by convention deg0=\deg 0 = -\infty. Every polynomial defines a function xP(x)x \mapsto P(x) on KK by substitution.

Proposition 8.2 (Degree rules; integral domain)

For P,QK[X]P, Q \in K[X]:

deg(P+Q)max(degP,degQ),deg(PQ)=degP+degQ.\deg(P + Q) \leq \max(\deg P, \deg Q), \qquad \deg(PQ) = \deg P + \deg Q .

Consequently K[X]K[X] is an integral domain, and its units are the nonzero constants.

Proof. The sum rule is clear (coefficients beyond the max vanish). For the product, let ama_m and bnb_n be the leading coefficients: the coefficient of Xm+nX^{m+n} in PQPQ is ambn0a_m b_n \neq 0 (KK is a field, hence an integral domain), and all higher coefficients vanish. If P,Q0P, Q \neq 0 then degPQ=degP+degQ0\deg PQ = \deg P + \deg Q \geq 0, so PQ0PQ \neq 0: integral domain. If PQ=1PQ = 1 then degP+degQ=0\deg P + \deg Q = 0 forces degP=degQ=0\deg P = \deg Q = 0: invertible elements are the invertible constants, i.e. all of KK^*.

Theorem 8.3 (Euclidean division)

Let A,BK[X]A, B \in K[X] with B0B \neq 0. There is exactly one pair (Q,R)(Q, R) of polynomials with

A=BQ+R,degR<degB.A = BQ + R, \qquad \deg R < \deg B .

Proof. Existence, by strong induction on degA\deg A. If degA<degB\deg A < \deg B, take (Q,R)=(0,A)(Q, R) = (0, A). Otherwise write A=aXm+A = a X^m + \dots, B=bXn+B = b X^n + \dots with mnm \geq n; the polynomial A1=AabXmnBA_1 = A - \frac ab X^{m-n} B has degree <m< m (the leading terms cancel), so by induction A1=BQ1+RA_1 = BQ_1 + R with degR<degB\deg R < \deg B, and A=B(Q1+abXmn)+RA = B(Q_1 + \frac ab X^{m-n}) + R.

Uniqueness: if BQ+R=BQ+RBQ + R = BQ' + R', then B(QQ)=RRB(Q - Q') = R' - R with deg(RR)<degB\deg(R' - R) < \deg B; by the degree rule this forces QQ=0Q - Q' = 0, then R=RR = R'.

Example 8.4

Divide A=X4+X32X+1A = X^4 + X^3 - 2X + 1 by B=X2+1B = X^2 + 1:

X4+X32X+1=(X2+1)(X2+X1)+(3X+2).X^4 + X^3 - 2X + 1 = (X^2 + 1)(X^2 + X - 1) + (-3X + 2).

(Compute: subtract X2BX^2 B, then XBX B, then B-B; the remainder 3X+2-3X + 2 has degree 1<21 < 2.)

Method 8.5 (Horner’s scheme)

To evaluate P=anXn++a0P = a_nX^n + \dots + a_0 at xx, or to divide PP by XxX - x, avoid computing powers: read the coefficients left to right, and iterate multiply by xx, add the next coefficient:

bn=an,bk=ak+xbk+1(k=n1,,0).b_n = a_n, \qquad b_{k} = a_{k} + x\,b_{k+1} \quad (k = n-1, \dots, 0) .

Then b0=P(x)b_0 = P(x), and the earlier bkb_k are the quotient’s coefficients: P=(Xx)(bnXn1++b1)+b0P = (X - x)(b_nX^{n-1} + \dots + b_1) + b_0 (expand and compare). Example: P=X45X3+6X2+4X8P = X^4 - 5X^3 + 6X^2 + 4X - 8 at x=2x = 2: the bb’s are 1,3,0,4,01, -3, 0, 4, 0, so P(2)=0P(2) = 0 and P=(X2)(X33X2+4)P = (X-2)(X^3 - 3X^2 + 4) — one line instead of a long division, and nn multiplications instead of the n2/2\approx n^2/2 of the naive evaluation. Iterating the scheme at the same point extracts multiplicities (compare Example 8.12).

Remark 8.6 (Arithmetic of K[X]K[X])

With Euclidean division in hand, the entire arithmetic of Chapter 6 transfers to K[X]K[X], with the same proofs, degree playing the role of absolute value: gcd (normalized to be monic), extended Euclidean algorithm, Bézout’s identity, Gauss’s lemma, irreducible polynomials and unique factorization. We freely use these transferred results, and Exercise 8.6 rehearses one of them.

8.2 Roots

Theorem 8.7 (Factor theorem)

Let PK[X]P \in K[X] and aKa \in K. The remainder of PP upon division by XaX - a is the constant P(a)P(a). In particular

P(a)=0    (Xa)P.P(a) = 0 \iff (X - a) \mid P .

More generally, distinct roots a1,,ara_1, \dots, a_r of PP give the factorization P=(Xa1)(Xar)QP = (X - a_1)\cdots(X - a_r)\, Q.

Proof. Divide: P=(Xa)Q+RP = (X - a) Q + R with degR<1\deg R < 1, so RR is a constant cc; substituting X=aX = a (substitution respects sums and products) gives P(a)=cP(a) = c. The equivalence follows. For several roots, induct on rr: the case r=1r = 1 is the equivalence just proved. Assume the statement for r1r - 1 roots and let a1,,ara_1, \dots, a_r be distinct roots of PP. Write P=(Xa1)Q1P = (X - a_1)Q_1; for each i2i \geq 2, substituting aia_i:

0=P(ai)=(aia1)Q1(ai),aia10,0 = P(a_i) = (a_i - a_1)\,Q_1(a_i), \qquad a_i - a_1 \neq 0 ,

and since KK has no zero divisors, Q1(ai)=0Q_1(a_i) = 0: the r1r - 1 distinct points a2,,ara_2, \dots, a_r are roots of Q1Q_1. The induction hypothesis factors Q1=(Xa2)(Xar)QQ_1 = (X - a_2)\cdots(X - a_r)\,Q, and substituting back gives the claim.

Corollary 8.8 (A polynomial of degree nn has at most nn roots)

A nonzero PK[X]P \in K[X] of degree nn has at most nn distinct roots in KK. Consequently, a polynomial (of degree n\leq n) vanishing at n+1n + 1 distinct points is the zero polynomial, and two polynomials of degree n\leq n agreeing at n+1n+1 points are equal.

Proof. If a1,,ara_1, \dots, a_r are distinct roots, Theorem 8.7 gives P=(Xa1)(Xar)QP = (X-a_1)\cdots(X-a_r) Q, so n=degPrn = \deg P \geq r. The two consequences follow by contradiction and by difference.

Example 8.9 (The auxiliary-polynomial trick)

Let PP be the polynomial of degree n\leq n with

P(k)=kk+1(k=0,1,,n);P(k) = \frac{k}{k+1} \qquad (k = 0, 1, \dots, n) ;

it exists and is unique by Lagrange interpolation below. What is P(n+1)P(n+1)? Clear denominators: the polynomial Q=(X+1)PXQ = (X+1)P - X has degree n+1\leq n + 1 and vanishes at the n+1n + 1 points 0,1,,n0, 1, \dots, n, so by Theorem 8.7

Q=cX(X1)(X2)(Xn)Q = c\,X(X-1)(X-2)\cdots(X-n)

for some constant cc. Evaluate where QQ is known independently: at X=1X = -1, Q(1)=0P(1)+1=1Q(-1) = 0 \cdot P(-1) + 1 = 1, while the product equals (1)(2)(1n)=(1)n+1(n+1)!(-1)(-2)\cdots(-1-n) = (-1)^{n+1}(n+1)!; hence c=(1)n+1(n+1)!c = \frac{(-1)^{n+1}}{(n+1)!}. Now evaluate at X=n+1X = n + 1:

(n+2)P(n+1)(n+1)=Q(n+1)=c(n+1)!=(1)n+1,(n+2)\,P(n+1) - (n+1) = Q(n+1) = c\,(n+1)! = (-1)^{n+1} ,

so P(n+1)=(n+1)+(1)n+1n+2P(n+1) = \dfrac{(n+1) + (-1)^{n+1}}{n+2}: equal to 11 for odd nn, and to nn+2\frac{n}{n+2} for even nn — the interpolating polynomial does not continue the pattern n+1n+2\frac{n+1}{n+2}. The trick to remember: encode the data as roots of an auxiliary polynomial, identify the unknown constant at a point outside the data, and harvest.

Definition 8.10 (Derivative, multiplicity)

The formal derivative of P=akXkP = \sum a_k X^k is P=k1kakXk1P' = \sum_{k \geq 1} k\,a_k X^{k-1}; it satisfies the usual rules (P+Q)=P+Q(P+Q)' = P' + Q', (PQ)=PQ+PQ(PQ)' = P'Q + PQ' (checked on monomials and extended by linearity). A root aa of PP has multiplicity m1m \geq 1 when (Xa)mP(X-a)^m \mid P but (Xa)m+1P(X-a)^{m+1} \nmid P; the root is simple if m=1m = 1, multiple if m2m \geq 2.

Proposition 8.11 (Multiplicity via derivatives)

aa is a root of PP of multiplicity m\geq m if and only if

P(a)=P(a)==P(m1)(a)=0.P(a) = P'(a) = \dots = P^{(m-1)}(a) = 0 .

In particular, aa is a multiple root of PP if and only if P(a)=P(a)=0P(a) = P'(a) = 0.

Proof. Write P=(Xa)mQ+RP = (X - a)^m Q + R where RR is the remainder of the division by (Xa)m(X-a)^m, degR<m\deg R < m. Differentiating km1k \leq m - 1 times and evaluating at aa: the first term contributes 00 (each derivative retains a factor (Xa)(X-a)), so P(k)(a)=R(k)(a)P^{(k)}(a) = R^{(k)}(a).

Now a polynomial RR of degree <m< m is determined by R(a),R(a),,R(m1)(a)R(a), R'(a), \dots, R^{(m-1)}(a): writing R=k<mck(Xa)kR = \sum_{k < m} c_k (X - a)^k (possible: expand powers of X=(Xa)+aX = (X - a) + a), one finds R(k)(a)=k!ckR^{(k)}(a) = k!\, c_k. Hence: all P(k)(a)=0P^{(k)}(a) = 0 for k<mk < m     \iff all ck=0c_k = 0     \iff R=0R = 0     \iff (Xa)mP(X-a)^m \mid P.

Example 8.12 (Computing a multiplicity)

What is the multiplicity of the root 22 in P=X45X3+6X2+4X8P = X^4 - 5X^3 + 6X^2 + 4X - 8? Evaluate the successive derivatives at 22:

P(2)=1640+24+88=0,P(2)=3260+24+4=0,P(2) = 16 - 40 + 24 + 8 - 8 = 0, \qquad P'(2) = 32 - 60 + 24 + 4 = 0,
P(2)=4860+12=0,P(2)=4830=180P''(2) = 48 - 60 + 12 = 0, \qquad P'''(2) = 48 - 30 = 18 \neq 0

(with P=4X315X2+12X+4P' = 4X^3 - 15X^2 + 12X + 4, P=12X230X+12P'' = 12X^2 - 30X + 12, P=24X30P''' = 24X - 30). Three vanishing values then a nonzero one: multiplicity exactly 33. Dividing, P=(X2)3(X+1)P = (X - 2)^3(X + 1) — which one checks by expanding (X2)3=X36X2+12X8(X-2)^3 = X^3 - 6X^2 + 12X - 8 and multiplying by X+1X + 1. The insight: multiplicities are read off evaluations, no factorization needed — which is exactly how one detects them when the factorization is out of reach.

Example 8.13 (Detecting multiple roots with a gcd)

When no root is known, Proposition 8.11 still gives a global multiple-root detector: aa is a multiple root of PP iff it is a common root of PP and PP', so PP has a multiple root (in C\C) iff gcd(P,P)1\gcd(P, P') \neq 1 — computable by the Euclidean algorithm without solving anything. Sample: P=X33X+2P = X^3 - 3X + 2, P=3X23=3(X1)(X+1)P' = 3X^2 - 3 = 3(X - 1)(X + 1). Testing the roots ±1\pm1 of PP' inside PP: P(1)=0P(1) = 0 but P(1)=4P(-1) = 4, so

gcd(P,P)=X1:\gcd(P, P') = X - 1 :

the root 11 is multiple; dividing twice, P=(X1)2(X+2)P = (X - 1)^2(X + 2). The gcd even reports the full set of multiple roots, each with multiplicity lowered by one — the fact every computer-algebra system exploits to “square-free factorize” before any root-hunting, and the polynomial twin of Exercise 8.9’s no-multiple-root arguments.

Theorem 8.14 (Fundamental theorem of algebra)

Every nonconstant polynomial of C[X]\C[X] has a root in C\C.

Proof. Admitted at this level.

Remark 8.15

Despite its name, the theorem is a statement of analysis: every known proof uses the completeness of R\R in some form, and none is purely algebraic — the honest proof is given in the Year 3 volume, once either complex integration or compactness arguments are available. What this chapter genuinely proves is the reduction: granted one root for every nonconstant polynomial, the full factorizations over C\C and R\R below follow by pure algebra.

Corollary 8.16 (Factorization over C\C and over R\R)

  1. Every nonzero PC[X]P \in \C[X] factors as

    P=c(Xa1)m1(Xar)mr,P = c\, (X - a_1)^{m_1} \cdots (X - a_r)^{m_r},

    with cc the leading coefficient, aia_i the distinct complex roots, mi=degP\sum m_i = \deg P: counted with multiplicity, a polynomial of degree nn has exactly nn complex roots.

  2. Every nonzero PR[X]P \in \R[X] factors over R\R as

    P=ci(Xai)mij(X2+pjX+qj)nj,P = c \prod_i (X - a_i)^{m_i} \prod_j (X^2 + p_j X + q_j)^{n_j},

    the quadratic factors being distinct with pj24qj<0p_j^2 - 4q_j < 0 (no real roots).

Proof. (1) Induction on the degree, splitting off one root at a time by Theorem 8.7; the count of degrees matches at each step.

(2) Let PP have real coefficients. If zz is a complex root of multiplicity mm, so is z\conj z: conjugating P(z)=0P(z) = 0 gives P(z)=P(z)=0P(\conj z) = \conj{P(z)} = 0 (the coefficients are their own conjugates), and the same applies to the derivatives (Proposition 8.11). Group the non-real roots in conjugate pairs: each pair contributes

(Xz)(Xz)=X22(z)X+z2,(X - z)(X - \conj z) = X^2 - 2\Re(z)\, X + \abs z^2 ,

a real quadratic with negative discriminant. The real roots contribute the linear factors.

Example 8.17

X4+4X^4 + 4 was factored over R\R in Exercise 3.5 by pairing the four complex roots ±1±i\pm 1 \pm \iu: X4+4=(X22X+2)(X2+2X+2)X^4 + 4 = (X^2 - 2X + 2)(X^2 + 2X + 2). Neither quadratic splits over R\R (discriminants 4-4). Note: an irreducible real polynomial has degree 11 or 22 — this is exactly what the factorization theorem says. The same conjugate-pairing run on X4+1X^4 + 1, whose roots are e±iπ/4\eu^{\pm\iu\pi/4} and e±3iπ/4\eu^{\pm3\iu\pi/4}: each pair contributes X22cosθX+1X^2 - 2\cos\theta\,X + 1, so

X4+1=(X22X+1)(X2+2X+1),X^4 + 1 = \bigl(X^2 - \sqrt2\,X + 1\bigr) \bigl(X^2 + \sqrt2\,X + 1\bigr) ,

an identity invisible to naive factoring attempts over Q\Q — the price of insisting on real (here even irrational) coefficients, and a standard input for integrating 1x4+1\frac1{x^4 + 1} in Chapter 15.

The Chebyshev polynomial T_5 = 16X5 - 20X3 + 5X on ∈tcc-11: it oscillates exactly between -1 and 1, touching the bounds at six points (marked). This equioscillation is what makes 2-4T_5 the monic quintic of smallest sup-norm on the interval ( and the weekend problem).
The Chebyshev polynomial T5=16X520X3+5XT_5 = 16X^5 - 20X^3 + 5X on [1,1]\intcc{-1}1: it oscillates exactly between 1-1 and 11, touching the bounds at six points (marked). This equioscillation is what makes 24T52^{-4}T_5 the monic quintic of smallest sup-norm on the interval (Exercise 8.10 and the weekend problem).

Remark 8.18 (Common pitfalls with polynomials)

  1. Polynomial versus function. Over K=Q,R,CK = \Q, \R, \C the two notions match (equal functions have equal coefficients, by Corollary 8.8 and infiniteness of KK), but conceptually a polynomial is its coefficient list: over the two-element field Z/2Z\Z/2\Z of Chapter 7, X2+XX^2 + X vanishes at both points, yet is not the zero polynomial.
  2. Degrees under addition. deg(P+Q)\deg(P + Q) can drop below max(degP,degQ)\max(\deg P, \deg Q) when leading terms cancel; writing “deg(P+Q)=max()\deg(P + Q) = \max(\dots)” is only safe for distinct degrees.
  3. Roots counted correctly.nn roots” in Corollary 8.16 means with multiplicity, in C\C: X2+1X^2 + 1 has no real roots, and (X1)2(X-1)^2 has one distinct root but two with multiplicity. Statements mixing the three counts are the commonest source of false proofs.
  4. Irreducibility depends on the field. X22X^2 - 2 is irreducible over Q\Q, splits over R\R; X2+1X^2 + 1 is irreducible over R\R, splits over C\C. The bare word “irreducible” means nothing until the coefficient field is named.

8.3 Coefficients and roots

Theorem 8.19 (Vieta’s formulas)

Let P=Xn+cn1Xn1++c0P = X^n + c_{n-1} X^{n-1} + \dots + c_0 be monic with roots a1,,anCa_1, \dots, a_n \in \C (with multiplicity). Then

iai=cn1,i<jaiaj=cn2,,a1a2an=(1)nc0,\sum_i a_i = -c_{n-1}, \qquad \sum_{i < j} a_i a_j = c_{n-2}, \qquad \dots, \qquad a_1 a_2 \cdots a_n = (-1)^n c_0 ,

the kk-th symmetric function of the roots being (1)kcnk(-1)^k c_{n-k}.

Proof. By Corollary 8.16, P=(Xa1)(Xan)P = (X - a_1)\cdots(X - a_n) (monic, all roots listed). Expanding the product distributively produces one term per way of choosing, in each factor, either XX or the root term ai-a_i: choosing the roots in the factors indexed by i1<<iki_1 < \dots < i_k and XX in the nkn - k others contributes (ai1)(aik)Xnk(-a_{i_1})\cdots(-a_{i_k})\,X^{n-k}. Grouping by the power of XX:

P=k=0n(1)k(i1<<ikai1aik)Xnk,P = \sum_{k=0}^{n} (-1)^k \Bigl(\sum_{i_1 < \dots < i_k} a_{i_1}\cdots a_{i_k}\Bigr) X^{n-k} ,

and identifying with P=kcnkXnkP = \sum_k c_{n-k}X^{n-k} (coefficients are unique, Definition 8.1) gives cnk=(1)kσkc_{n-k} = (-1)^k \sigma_k, i.e. σk=(1)kcnk\sigma_k = (-1)^kc_{n-k}, where σk\sigma_k denotes the kk-th symmetric function displayed above. The three displayed cases are k=1k = 1, k=2k = 2 and k=nk = n.

Example 8.20

For the quadratic X2sX+pX^2 - sX + p: sum of roots ss, product pp — already used repeatedly (Exercise 3.8). For a monic cubic X3+aX2+bX+cX^3 + aX^2 + bX + c with roots α,β,γ\alpha, \beta, \gamma:

α+β+γ=a,αβ+βγ+γα=b,αβγ=c,\alpha + \beta + \gamma = -a, \quad \alpha\beta + \beta\gamma + \gamma\alpha = b, \quad \alpha\beta\gamma = -c ,

which allows computing symmetric quantities like α2+β2+γ2=a22b\alpha^2 + \beta^2 + \gamma^2 = a^2 - 2b without solving.

Example 8.21 (Transforming the roots without finding them)

Let α,β\alpha, \beta be the roots of X23X+1X^2 - 3X + 1. Which monic quadratic has roots α2,β2\alpha^2, \beta^2? By Vieta, α+β=3\alpha + \beta = 3 and αβ=1\alpha\beta = 1, so

α2+β2=(α+β)22αβ=7,α2β2=(αβ)2=1:\alpha^2 + \beta^2 = (\alpha+\beta)^2 - 2\alpha\beta = 7, \qquad \alpha^2\beta^2 = (\alpha\beta)^2 = 1 :

the answer is X27X+1X^2 - 7X + 1 — obtained without computing α=3+52\alpha = \frac{3 + \sqrt5}2. (Check: α2=7+352\alpha^2 = \frac{7 + 3\sqrt5}2 and indeed α2+β2=7\alpha^2 + \beta^2 = 7.) The same strategy handles reciprocals (X2baX+caX^2 - \frac ba X + \frac ca-type transformations), shifts, and any symmetric data: Vieta converts questions about unknown roots into algebra on known coefficients. It will serve constantly when the roots are eigenvalues (Chapter 22).

Example 8.22 (Palindromic equations)

Solve X4+X34X2+X+1=0X^4 + X^3 - 4X^2 + X + 1 = 0. The coefficients read the same in both directions, so 00 is not a root and dividing by X2X^2 loses no solutions:

X2+X4+1X+1X2=0.X^2 + X - 4 + \frac1X + \frac1{X^2} = 0 .

Set y=X+1Xy = X + \frac1X: then X2+1X2=y22X^2 + \frac1{X^2} = y^2 - 2, and the equation collapses to

y2+y6=0    (y+3)(y2)=0.y^2 + y - 6 = 0 \iff (y + 3)(y - 2) = 0 .

Unfold each value through X2yX+1=0X^2 - yX + 1 = 0: for y=2y = 2, X22X+1=(X1)2X^2 - 2X + 1 = (X - 1)^2 gives the double root 11; for y=3y = -3, X2+3X+1=0X^2 + 3X + 1 = 0 gives X=3±52X = \frac{-3 \pm \sqrt5}2. Four roots with multiplicity for a quartic, as Corollary 8.16 requires — obtained by solving two quadratics. The trick covers every palindromic polynomial: their roots come in reciprocal pairs {x,1/x}\{x, 1/x\} (replace XX by 1/X1/X and clear denominators), and y=X+1Xy = X + \frac1X is precisely the quantity constant on such pairs, halving the degree.

Theorem 8.23 (Lagrange interpolation)

Let x0,,xnx_0, \dots, x_n be distinct points of KK and y0,,ynKy_0, \dots, y_n \in K. There is exactly one PK[X]P \in K[X] of degree n\leq n with P(xi)=yiP(x_i) = y_i for all ii, namely

P=i=0nyiLi,Li=jiXxjxixj.P = \sum_{i=0}^{n} y_i\, L_i, \qquad L_i = \prod_{j \neq i} \frac{X - x_j}{x_i - x_j} .

Proof. Each LiL_i has degree nn and satisfies Li(xi)=1L_i(x_i) = 1, Li(xj)=0L_i(x_j) = 0 for jij \neq i (each factor vanishes at the corresponding xjx_j). So the displayed PP has degree n\leq n and interpolates. Uniqueness: two interpolating polynomials of degree n\leq n agree at the n+1n+1 points xix_i, hence are equal (Corollary 8.8).

Remark 8.24 (Interlude: polynomials are also vectors)

A change of viewpoint that Chapter 18 will make official: the polynomials of degree n\leq n form a space in which addition and scaling behave exactly like coordinates — a polynomial is its list of n+1n + 1 coefficients. Three statements of this chapter are secretly linear algebra. Lagrange interpolation (Theorem 8.23) says that the evaluation data (P(x0),,P(xn))(P(x_0), \dots, P(x_n)) determines PP uniquely: evaluation at n+1n + 1 points is a linear bijection, and the LiL_i are the basis adapted to it. The expansion R=ck(Xa)kR = \sum c_k(X - a)^k in the proof of Proposition 8.11 says that the powers of (Xa)(X - a) form another coordinate system, with ck=R(k)(a)/k!c_k = R^{(k)}(a)/k! as coordinates. And Corollary 8.8 — more roots than the degree forces the zero polynomial — is the engine of all uniqueness: it will become “a linear map injective on a space of dimension n+1n + 1” in Chapter 19. When those chapters arrive, the space Kn[X]K_n[X] will be their favorite example; it is worth arriving there already fluent in it.

Remark 8.25 (Where this chapter is used)

Factorization over R\R and C\C (Corollary 8.16) is the engine of partial fractions in Chapter 9, hence of a large class of integrals in Chapter 15. The expansion of a polynomial in powers of (Xa)(X - a), met in the proof of Proposition 8.11, is the algebraic shadow of the Taylor formulas of Chapter 16. Characteristic polynomials already appeared for differential equations (Chapter 5) and return for matrices in Chapter 22; Lagrange interpolation is the first existence-and-uniqueness theorem of numerical analysis, and the Chebyshev polynomials of Exercise 8.10 — whose optimality the weekend problem below establishes — tell that discipline where to interpolate. Finally the whole arithmetic of K[X]K[X], copied from Chapter 6, feeds the study of K[X]K[X]-ideals and quotient rings in the Year 2 volume.

8.4 Exercises

Exercise 8.1

Carry out the Euclidean divisions: X51X^5 - 1 by X2+X+1X^2 + X + 1; then 2X4+X3X+32X^4 + X^3 - X + 3 by X22X^2 - 2.

Solution

Solution of Exercise 8.1.

X51=(X2+X+1)(X3X2+1)+(X2)X^5 - 1 = (X^2 + X + 1)(X^3 - X^2 + 1) + (-X - 2). Steps: subtract X3BX^3 B, then X2B-X^2 B, then BB; the remainder X2-X - 2 has degree 1<21 < 2. Check at X=1X = 1:   0=3×1+(3)\;0 = 3 \times 1 + (-3).

2X4+X3X+3=(X22)(2X2+X+4)+(X+11)2X^4 + X^3 - X + 3 = (X^2 - 2)(2X^2 + X + 4) + (X + 11). Check at X=0X = 0:   3=(2)(4)+11\;3 = (-2)(4) + 11.

Exercise 8.2

For which nNn \in \N does X2+X+1X^2 + X + 1 divide X2n+Xn+1X^{2n} + X^n + 1? Hint: the roots of X2+X+1X^2 + X + 1 are jj and j2j^2 with j=e2iπ/3j = \eu^{2\iu\pi/3}; discuss nn mod 33.

Solution

Solution of Exercise 8.2.

X2+X+1=(Xj)(Xj2)X^2 + X + 1 = (X - j)(X - j^2) with j=e2iπ/3j = \eu^{2\iu\pi/3}, j3=1j^3 = 1. It divides Qn=X2n+Xn+1Q_n = X^{2n} + X^n + 1 iff jj and j2j^2 are roots of QnQ_n; since QnQ_n has real coefficients, Qn(j2)=Qn(j)Q_n(j^2) = \conj{Q_n(j)}, so the condition is just Qn(j)=0Q_n(j) = 0. Now Qn(j)=j2n+jn+1Q_n(j) = j^{2n} + j^n + 1 depends on nn mod 33:

  • n0n \equiv 0: Qn(j)=1+1+1=30Q_n(j) = 1 + 1 + 1 = 3 \neq 0;
  • n1n \equiv 1: Qn(j)=j2+j+1=0Q_n(j) = j^2 + j + 1 = 0;
  • n2n \equiv 2: Qn(j)=j4+j2+1=j+j2+1=0Q_n(j) = j^4 + j^2 + 1 = j + j^2 + 1 = 0.

So X2+X+1X2n+Xn+1X^2 + X + 1 \mid X^{2n} + X^n + 1 exactly when 3n3 \nmid n.

Exercise 8.3

Determine the real a,ba, b so that (X1)2(X-1)^2 divides P=X4+aX3+bX2+1P = X^4 + aX^3 + bX^2 + 1, then factor PP over R\R for these values.

Solution

Solution of Exercise 8.3.

By Proposition 8.11, (X1)2P(X-1)^2 \mid P iff P(1)=P(1)=0P(1) = P'(1) = 0:

P(1)=2+a+b=0,P(1)=4+3a+2b=0.P(1) = 2 + a + b = 0, \qquad P'(1) = 4 + 3a + 2b = 0 .

Solving: b=a2b = -a - 2 and 4+3a2a4=a=04 + 3a - 2a - 4 = a = 0, so a=0a = 0, b=2b = -2: P=X42X2+1=(X21)2=(X1)2(X+1)2P = X^4 - 2X^2 + 1 = (X^2 - 1)^2 = (X-1)^2 (X+1)^2, which is the real factorization.

Exercise 8.4

Factor over C\C and over R\R: X31X^3 - 1;   X4+X2+1\;X^4 + X^2 + 1;   X61\;X^6 - 1.

Solution

Solution of Exercise 8.4.

X31=(X1)(Xj)(Xj2)X^3 - 1 = (X - 1)(X - j)(X - j^2) over C\C (j=e2iπ/3j = \eu^{2\iu\pi/3}), and (X1)(X2+X+1)(X - 1)(X^2 + X + 1) over R\R.

X4+X2+1=(X2+X+1)(X2X+1)X^4 + X^2 + 1 = (X^2 + X + 1)(X^2 - X + 1) over R\R (multiply out, or note X4+X2+1=(X2+1)2X2X^4 + X^2 + 1 = (X^2+1)^2 - X^2); over C\C, each quadratic splits: roots j,j2j, j^2 and j,j2-j, -j^2, i.e. e±2iπ/3,e±iπ/3\eu^{\pm 2\iu\pi/3}, \eu^{\pm\iu\pi/3}.

X61=k=05(Xeikπ/3)X^6 - 1 = \prod_{k=0}^{5} (X - \eu^{\iu k\pi/3}) over C\C, and over R\R:

X61=(X1)(X+1)(X2+X+1)(X2X+1),X^6 - 1 = (X-1)(X+1)(X^2 + X + 1)(X^2 - X + 1),

grouping the conjugate pairs e±2iπ/3\eu^{\pm 2\iu\pi/3} and e±iπ/3\eu^{\pm \iu\pi/3}.

Exercise 8.5 ★★

Let P=X36X2+11X6P = X^3 - 6X^2 + 11X - 6.

  1. Find the rational roots (a rational root p/qp/q in lowest terms of a monic integer polynomial is an integer dividing the constant term — prove it), and factor PP.
  2. Without solving, compute the sum of the squares and the sum of the inverses of the roots via Vieta, and check on the factorization.
Solution

Solution of Exercise 8.5.

  1. Let p/qp/q (lowest terms) be a root of the monic integer polynomial X3++c0X^3 + \dots + c_0: clearing denominators in P(p/q)=0P(p/q) = 0 gives p3=q(integer)p^3 = -q\,(\text{integer}), so qp3q \mid p^3; coprimality forces q=±1q = \pm 1: the root is an integer pp, and pc0p \mid c_0 (isolate c0c_0). Here the candidates divide 66: testing, P(1)=0P(1) = 0, P(2)=0P(2) = 0, P(3)=0P(3) = 0. So P=(X1)(X2)(X3)P = (X-1)(X-2)(X-3).
  2. Vieta: s1=6s_1 = 6, s2=11s_2 = 11, s3=6s_3 = 6. Sum of squares: s122s2=3622=14=1+4+9s_1^2 - 2s_2 = 36 - 22 = 14 = 1 + 4 + 9, as expected. Sum of inverses: s2s3=116=1+12+13\frac{s_2}{s_3} = \frac{11}{6} = 1 + \frac12 + \frac13, as expected.

Exercise 8.6 ★★

Compute gcd(X41,  X3X2+X1)\gcd(X^4 - 1,\; X^3 - X^2 + X - 1) by the Euclidean algorithm, and write it as a combination AU+BVAU + BV of the two polynomials.

Solution

Solution of Exercise 8.6.

First division step of the Euclidean algorithm:

(X+1)(X3X2+X1)=X4X3+X2X+X3X2+X1=X41,(X + 1)(X^3 - X^2 + X - 1) = X^4 - X^3 + X^2 - X + X^3 - X^2 + X - 1 = X^4 - 1 ,

so the division of X41X^4 - 1 by X3X2+X1X^3 - X^2 + X - 1 is exact (quotient X+1X + 1, remainder 00), and the algorithm stops at once:

gcd(X41,  X3X2+X1)=X3X2+X1\gcd(X^4 - 1,\; X^3 - X^2 + X - 1) = X^3 - X^2 + X - 1

(already monic). The Bézout relation is the trivial one: gcd=0(X41)+1(X3X2+X1)\gcd = 0 \cdot (X^4 - 1) + 1 \cdot (X^3 - X^2 + X - 1). Consistency check by factoring: X3X2+X1=(X1)(X2+1)X^3 - X^2 + X - 1 = (X - 1)(X^2 + 1), which is indeed the product of the common irreducible factors of X41=(X1)(X+1)(X2+1)X^4 - 1 = (X-1)(X+1)(X^2+1).

Exercise 8.7 ★★

Let PR[X]P \in \R[X] with P(x)0P(x) \geq 0 for all xRx \in \R. Prove that PP is a sum of two squares of real polynomials: P=A2+B2P = A^2 + B^2. Hint: in the real factorization, real roots have even multiplicity; write the quadratic factors as (Xz)(Xz)(X - z)(X - \conj z) and use 2=()2+()2\abs{\,\cdot\,}^2 = (\Re)^2 + (\Im)^2 on the product of the (Xz)(X - z)’s.

Solution

Solution of Exercise 8.7.

Since P0P \geq 0 on R\R, its real roots have even multiplicity (at a root of odd multiplicity, PP changes sign). Using Corollary 8.16 and pairing, write

P=ci(Xai)2kij((Xzj)(Xzj))nj,P = c \prod_i (X - a_i)^{2k_i} \prod_j \bigl((X - z_j)(X - \conj z_j)\bigr)^{n_j},

with c>0c > 0 (behavior at ++\infty). Let

S=ci(Xai)kij(Xzj)njC[X],S = \sqrt c\, \prod_i (X - a_i)^{k_i} \prod_j (X - z_j)^{n_j} \in \C[X],

so that P=SSP = S\,\conj S where S\conj S has the conjugated coefficients. Split S=A+iBS = A + \iu B with A,BR[X]A, B \in \R[X]: then

P=(A+iB)(AiB)=A2+B2.P = (A + \iu B)(A - \iu B) = A^2 + B^2 .

Exercise 8.8 ★★

Find the polynomial PP of degree 2\leq 2 with P(0)=1P(0) = 1, P(1)=3P(1) = 3, P(2)=2P(2) = 2, first by Lagrange’s formula, then by solving the linear system on the coefficients. Verify both answers agree.

Solution

Solution of Exercise 8.8.

Lagrange (Theorem 8.23) with nodes 0,1,20, 1, 2:

P=1(X1)(X2)(01)(02)+3X(X2)1(12)+2X(X1)21=(X1)(X2)23X(X2)+X(X1).P = 1\cdot\frac{(X-1)(X-2)}{(0-1)(0-2)} + 3\cdot\frac{X(X-2)}{1\cdot(1-2)} + 2\cdot\frac{X(X-1)}{2\cdot 1} = \frac{(X-1)(X-2)}{2} - 3X(X-2) + X(X-1).

Expanding: X23X+223X2+6X+X2X=32X2+72X+1\frac{X^2 - 3X + 2}{2} - 3X^2 + 6X + X^2 - X = -\frac{3}{2}X^2 + \frac{7}{2}X + 1.

System: P=aX2+bX+cP = aX^2 + bX + c with c=1c = 1; a+b+1=3a + b + 1 = 3; 4a+2b+1=24a + 2b + 1 = 2. Subtracting twice the second from the third: 2a1=42a - 1 = -4, so a=32a = -\frac32, b=72b = \frac72. Same polynomial: P=32X2+72X+1P = -\frac32 X^2 + \frac72 X + 1. (Check P(2)=6+7+1=2P(2) = -6 + 7 + 1 = 2.)

Exercise 8.9 ★★

Prove that P=X2n+11P = X^{2n+1} - 1 has exactly one real root, and that for every n1n \geq 1 the polynomial 1+X+X22!++Xnn!1 + X + \frac{X^2}{2!} + \dots + \frac{X^n}{n!} has no multiple root (compare PP and PP').

Solution

Solution of Exercise 8.9.

P=X2n+11P = X^{2n+1} - 1: P=(2n+1)X2n0P' = (2n+1)X^{2n} \geq 0, so the polynomial function is increasing (strictly except at 00), with limits \mp\infty: it vanishes exactly once on R\R (at x=1x = 1).

Let En=k=0nXkk!E_n = \sum_{k=0}^{n} \frac{X^k}{k!}. Then En=En1=EnXnn!E_n' = E_{n-1} = E_n - \frac{X^n}{n!}. A multiple root aa would satisfy En(a)=En(a)=0E_n(a) = E_n'(a) = 0 (Proposition 8.11), hence ann!=En(a)En(a)=0\frac{a^n}{n!} = E_n(a) - E_n'(a) = 0, so a=0a = 0; but En(0)=10E_n(0) = 1 \neq 0. No multiple root.

Exercise 8.10 ★★★

(Chebyshev polynomials) Define T0=1T_0 = 1, T1=XT_1 = X and Tn+1=2XTnTn1T_{n+1} = 2X\,T_n - T_{n-1}.

  1. Prove by induction that Tn(cosθ)=cosnθT_n(\cos\theta) = \cos n\theta for all θ\theta.
  2. Deduce the nn roots of TnT_n and its leading coefficient.
  3. Prove that supx[1,1]Tn(x)=1\sup_{x \in \intcc{-1}{1}} \abs{T_n(x)} = 1, attained at n+1n + 1 points of [1,1]\intcc{-1}{1}.
Solution

Solution of Exercise 8.10.

  1. Induction (two base cases hold). Using cos(n+1)θ+cos(n1)θ=2cosθcosnθ\cos(n+1)\theta + \cos(n-1)\theta = 2\cos\theta\cos n\theta:

    Tn+1(cosθ)=2cosθcosnθcos(n1)θ=cos(n+1)θ.T_{n+1}(\cos\theta) = 2\cos\theta \cos n\theta - \cos(n-1)\theta = \cos(n+1)\theta .
  2. Tn(cosθ)=0T_n(\cos\theta) = 0 iff nθπ2(modπ)n\theta \equiv \frac\pi2 \pmod \pi: the numbers

    xk=cos((2k+1)π2n),k=0,1,,n1,x_k = \cos\Bigl(\frac{(2k+1)\pi}{2n}\Bigr), \qquad k = 0, 1, \dots, n-1,

    are nn distinct points of (1,1)\intoo{-1}{1} (the angles lie in (0,π)\intoo{0}{\pi} where cos\cos is injective), all roots of TnT_n; since degTn=n\deg T_n = n (from the recurrence, with leading coefficient 2n12^{n-1} for n1n \geq 1, by induction), these are all the roots, each simple.

  3. For x=cosθ[1,1]x = \cos\theta \in \intcc{-1}{1}: Tn(x)=cosnθ1\abs{T_n(x)} = \abs{\cos n\theta} \leq 1, with equality iff nθ0(modπ)n\theta \equiv 0 \pmod\pi, i.e. at the n+1n+1 points yk=coskπny_k = \cos\frac{k\pi}{n}, k=0,,nk = 0, \dots, n, where Tn(yk)=(1)kT_n(y_k) = (-1)^k. (This equioscillation makes 21nTn2^{1-n}T_n the monic degree-nn polynomial of smallest sup-norm on [1,1]\intcc{-1}{1} — proved in this chapter’s weekend problem.)

Exercise 8.11 ★★★

Let PC[X]P \in \C[X] be nonconstant with distinct roots a1,,ara_1, \dots, a_r (multiplicities m1,,mrm_1, \dots, m_r). Prove the identity of rational functions

P(X)P(X)=i=1rmiXai,\frac{P'(X)}{P(X)} = \sum_{i=1}^{r} \frac{m_i}{X - a_i},

and deduce the Gauss–Lucas theorem: every root of PP' lies in the convex hull of the roots of PP (evaluate the identity at a root ww of PP' which is not a root of PP, take conjugates, and read the result as ww being a weighted average of the aia_i).

Solution

Solution of Exercise 8.11.

Write P=ci(Xai)miP = c\prod_i (X - a_i)^{m_i}. The product rule (extended to several factors) gives

P=cimi(Xai)mi1ki(Xak)mk,P' = c\sum_{i} m_i (X - a_i)^{m_i - 1} \prod_{k \neq i} (X - a_k)^{m_k},

and dividing by PP: PP=imiXai\frac{P'}{P} = \sum_i \frac{m_i}{X - a_i} (as rational functions, i.e. away from the roots).

Let ww be a root of PP'. If ww is one of the aia_i, it lies in the convex hull trivially. Otherwise, evaluating at ww:

0=imiwai=imiwaiwai2.0 = \sum_i \frac{m_i}{w - a_i} = \sum_i m_i\, \frac{\conj w - \conj a_i}{\abs{w - a_i}^2} .

Conjugating: iλi(wai)=0\sum_i \lambda_i (w - a_i) = 0 where λi=miwai2>0\lambda_i = \frac{m_i}{\abs{w - a_i}^2} > 0. Hence

w=iλiaiiλi:w = \frac{\sum_i \lambda_i a_i}{\sum_i \lambda_i} :

a convex combination (positive weights summing to 11 after normalization) of the roots aia_i. So every root of PP' lies in the convex hull of the roots of PP.

Exercise 8.12 ★★

(Roots-of-unity filter) Let nNn \in \N^* and j=e2iπ/3j = \eu^{2\iu\pi/3}. Evaluating (1+X)n(1 + X)^n at 11, jj and j2j^2, prove that

k0(n3k)=2n+2cosnπ33,\sum_{k \geq 0} \binom{n}{3k} = \frac{2^n + 2\cos\frac{n\pi}{3}}{3} ,

and check the formula for n=3n = 3 and n=6n = 6. Hint: 1+jm+j2m1 + j^m + j^{2m} equals 33 if 3m3 \mid m and 00 otherwise; and 1+j=eiπ/31 + j = \eu^{\iu\pi/3}.

Solution

Solution of Exercise 8.12.

Sum the evaluations of (1+X)n(1 + X)^n at the three cube roots of unity:

2n+(1+j)n+(1+j2)n=k=0n(nk)(1+jk+j2k)=3k:3k(nk),2^n + (1 + j)^n + (1 + j^2)^n = \sum_{k=0}^n \binom nk\,\bigl(1 + j^k + j^{2k}\bigr) = 3\sum_{k\,:\,3\mid k}\binom nk ,

since 1+jk+j2k1 + j^k + j^{2k} is a geometric sum equal to 33 when 3k3 \mid k and to j3k1jk1=0\frac{j^{3k} - 1}{j^k - 1} = 0 otherwise. Now 1+j=12+i32=eiπ/31 + j = \frac12 + \iu\frac{\sqrt3}2 = \eu^{\iu\pi/3} and 1+j2=1+j=eiπ/31 + j^2 = \conj{1 + j} = \eu^{-\iu\pi/3}, so (1+j)n+(1+j2)n=2cosnπ3(1+j)^n + (1+j^2)^n = 2\cos\frac{n\pi}3 and

k0(n3k)=2n+2cosnπ33.\sum_{k\geq0}\binom n{3k} = \frac{2^n + 2\cos\frac{n\pi}3}{3} .

Checks: n=3n = 3: 8+2cosπ3=2=(30)+(33)\frac{8 + 2\cos\pi}3 = 2 = \binom30 + \binom33; n=6n = 6: 64+23=22=1+20+1\frac{64 + 2}3 = 22 = 1 + 20 + 1.

8.5 Problem: Chebyshev polynomials and the flattest polynomial

Problem 8.1

Among all monic polynomials of degree nn, which one stays closest to zero on [1,1]\intcc{-1}1? The answer — Chebyshev’s theorem, the birth certificate of approximation theory — is 21nTn2^{1-n}T_n, where TnT_n is the Chebyshev polynomial of Exercise 8.10, and no monic competitor can beat its deviation 21n2^{1-n}. This problem develops the algebra of the family (Tn)(T_n) (composition law, explicit coefficients, the second-kind family UnU_n, a differential equation), proves the extremality theorem with its equality case, and collects applications: optimal interpolation nodes, the exact value of cos36\cos 36^\circ, and a congruence TpXp(modp)T_p \equiv X^p \pmod p. Throughout, T0=1T_0 = 1, T1=XT_1 = X, Tn+1=2XTnTn1T_{n+1} = 2X\,T_n - T_{n-1}, and we freely use Tn(cosθ)=cosnθT_n(\cos\theta) = \cos n\theta from Exercise 8.10.

Part I — The family (Tn)(T_n).

  1. Compute T2,T3,T4,T5T_2, T_3, T_4, T_5 from the recurrence. (Compare T3T_3 with the identity cos3θ=4cos3θ3cosθ\cos3\theta = 4\cos^3\theta - 3\cos\theta of Example 3.9.)
  2. Prove by induction: degTn=n\deg T_n = n with leading coefficient 2n12^{n-1} for n1n \geq 1, and TnT_n has the parity of nn (only even or only odd powers appear).
  3. Prove the uniqueness principle: TnT_n is the only polynomial satisfying P(cosθ)=cosnθP(\cos\theta) = \cos n\theta for all θ\theta. (Two polynomials agreeing on [1,1]\intcc{-1}1 agree everywhere: Corollary 8.8.)
  4. Deduce the composition and product laws:

    TmTn=Tmn,2TmTn=Tm+n+Tmn.T_m \circ T_n = T_{mn}, \qquad 2\,T_m T_n = T_{m+n} + T_{\abs{m-n}} .
  5. Recall from Exercise 8.10 the roots xk=cos(2k+1)π2nx_k = \cos\frac{(2k+1)\pi}{2n} and the equioscillation points yk=coskπny_k = \cos\frac{k\pi}n with Tn(yk)=(1)kT_n(y_k) = (-1)^k. Write down the complete factorization of TnT_n over R\R, and justify that the yky_k interlace: yn<xn1<yn1<<x0<y0y_n < x_{n-1} < y_{n-1} < \dots < x_0 < y_0.
  6. Prove that Tn(cosht)=cosh(nt)T_n(\cosh t) = \cosh(nt) for all tRt \in \R (same induction, using Proposition 4.18), and deduce for x1x \geq 1 the closed form

    Tn(x)=(x+x21)n+(xx21)n2,T_n(x) = \frac{\bigl(x + \sqrt{x^2 - 1}\bigr)^n + \bigl(x - \sqrt{x^2 - 1}\bigr)^n}{2} ,

    so Tn(x)>1T_n(x) > 1 for x>1x > 1: outside [1,1]\intcc{-1}1 the polynomial escapes at once.

Part II — Coefficients, the family UnU_n, a differential equation.

  1. From de Moivre’s formula (Corollary 3.8), prove the explicit expression

    Tn(x)=02jn(n2j)xn2j(x21)j,T_n(x) = \sum_{0 \leq 2j \leq n} \binom{n}{2j}\, x^{\,n-2j}\,(x^2 - 1)^j ,

    and verify it for n=3n = 3.

  2. Compute Tn(1)T_n(1), Tn(1)T_n(-1) and Tn(0)T_n(0) for all nn.
  3. Define UnU_n (second kind) by U0=1U_0 = 1, U1=2XU_1 = 2X, Un+1=2XUnUn1U_{n+1} = 2X\,U_n - U_{n-1}. Prove that Un(cosθ)=sin(n+1)θsinθU_n(\cos\theta) = \frac{\sin(n+1)\theta}{\sin\theta} for θπZ\theta \notin \pi\Z, and that Tn=nUn1T_n' = n\,U_{n-1} for n1n \geq 1.
  4. Prove that sinnθnsinθ\abs{\sin n\theta} \leq n\,\abs{\sin\theta} for all θ\theta (induction), and deduce the Markov-type bound

    Tn(x)n2on [1,1],with Tn(±1)=(±1)n1n2.\abs{T_n'(x)} \leq n^2 \quad\text{on } \intcc{-1}1, \qquad\text{with } T_n'(\pm1) = (\pm1)^{n-1}\,n^2 .
  5. Show that y=Tny = T_n satisfies the differential equation

    (1x2)yxy+n2y=0,(1 - x^2)\,y'' - x\,y' + n^2\,y = 0 ,

    by differentiating the identity sinθTn(cosθ)=nsinnθ\sin\theta\, T_n'(\cos\theta) = n\sin n\theta with respect to θ\theta; verify directly for T2T_2.

Part III — Chebyshev’s extremality theorem. Let T~n=21nTn\widetilde T_n = 2^{1-n}\,T_n (monic by question 2) and write P=supx[1,1]P(x)\norm{P}_\infty = \sup_{x \in \intcc{-1}1}\abs{P(x)}.

  1. Justify T~n=21n\norm{\widetilde T_n}_\infty = 2^{1-n}, attained with alternating signs at the n+1n + 1 points yn<<y0y_n < \dots < y_0.
  2. Suppose some monic PP of degree nn had P<21n\norm P_\infty < 2^{1-n}, and set D=T~nPD = \widetilde T_n - P. Show degDn1\deg D \leq n - 1, and that D(yk)D(y_k) has the strict sign of (1)k(-1)^k for each k=0,,nk = 0, \dots, n.
  3. Deduce that DD has at least nn distinct real roots (one in each gap, by the intermediate value property, used here at High School level and proved in Chapter 13), and conclude Chebyshev’s theorem: every monic PP of degree nn satisfies

    P21n.\norm{P}_\infty \geq 2^{1-n} .
  4. (Equality case, first step) Suppose now P=21n\norm P_\infty = 2^{1-n} exactly, PP monic of degree nn, and let D=T~nPD = \widetilde T_n - P. Show that (1)kD(yk)0(-1)^kD(y_k) \geq 0 for all kk, and that if D(yk)=0D(y_k) = 0 for an interior point yky_k (0<k<n0 < k < n), then D(yk)=0D'(y_k) = 0 as well. (At an interior yky_k, both T~n\widetilde T_n and PP attain an extremum of absolute value \norm{\cdot} _\infty; a differentiable function has zero derivative at an interior extremum — used at High School level, proved in Chapter 14.)
  5. (Equality case, conclusion) Count roots of DD with multiplicity to show D=0D = 0: the minimizer is unique, P=T~nP = \widetilde T_n.
  6. Transport to an arbitrary segment [a,b]\intcc ab: show that the minimal sup-norm of a monic degree-nn polynomial on [a,b]\intcc ab is 2(ba4)n2\bigl(\frac{b-a}4\bigr)^n, attained by a rescaled Chebyshev polynomial. (Substitute x=a+b2+ba2tx = \frac{a+b}2 + \frac{b-a}2\,t and track the leading coefficient.)

Part IV — Applications.

  1. Work out the case n=3n = 3 by hand: locate the extrema of T~3=X334X\widetilde T_3 = X^3 - \frac34X on [1,1]\intcc{-1}1, verify the four-fold equioscillation with value 14\frac14, and conclude that no monic cubic does better.
  2. (Optimal interpolation nodes) For n+1n + 1 nodes x0,,xn[1,1]x_0, \dots, x_n \in \intcc{-1}1, the interpolation error is governed by ω(X)=i(Xxi)\omega(X) = \prod_i (X - x_i) (as Chapter 16 will quantify). Prove that the choice minimizing ω\norm\omega_\infty is the set of n+1n + 1 roots of Tn+1T_{n+1}, with ω=2n\norm\omega_\infty = 2^{-n}: Chebyshev nodes are the right places to interpolate.
  3. Using T5T_5, prove that c=cos36c = \cos 36^\circ satisfies 16c520c3+5c+1=016c^5 - 20c^3 + 5c + 1 = 0, factor this polynomial as (x+1)(4x22x1)2(x + 1)(4x^2 - 2x - 1)^2, and conclude

    cos36=1+54.\cos 36^\circ = \frac{1 + \sqrt5}4 .

    Check the consistency with cos72=514\cos 72^\circ = \frac{\sqrt5 - 1}4 from Exercise 3.8.

  4. Estimate T10(1.1)T_{10}(1.1) with the closed form of question 6 (two significant digits suffice), and interpret: a polynomial bounded by 11 on [1,1]\intcc{-1}1 can already exceed 4040 at x=1.1x = 1.1. (That TnT_n grows fastest among such polynomials is another extremal property of the family, beyond this problem.)
  5. Prove the congruence: for every odd prime pp, all coefficients of TpXpT_p - X^p are divisible by pp. (Use question 7 and p(p2j)p \mid \binom p{2j} for 0<2j<p0 < 2j < p, from the proof of Theorem 6.23.) Verify on T3T_3 and T5T_5.

Part V — Synthesis.

  1. Compute explicitly the monic quadratic of minimal sup-norm on [0,1]\intcc01 and its deviation. (Question 17 with n=2n = 2.)
  2. Where exactly did the problem use: (i) the rigidity of polynomials (Corollary 8.8); (ii) the trigonometry of Chapter 3 and Chapter 4; (iii) the arithmetic of binomial coefficients from Chapter 6? One sentence each.
  3. Synthesis, in a short paragraph: the theorem says that the flattest monic polynomial is the one that equioscillates, and the proof converts optimality into root-counting. Comment on this mechanism, on the role of the substitution x=cosθx = \cos\theta as a bridge between algebra and trigonometry, and name the two places where the problem needed analysis facts (IVT, interior extremum) that later chapters prove.
Solution

Solution of Problem 8.1.

1. T2=2X21T_2 = 2X^2 - 1; T3=2X(2X21)X=4X33XT_3 = 2X(2X^2 - 1) - X = 4X^3 - 3X; T4=2XT3T2=8X48X2+1T_4 = 2X\,T_3 - T_2 = 8X^4 - 8X^2 + 1; T5=2XT4T3=16X520X3+5XT_5 = 2X\,T_4 - T_3 = 16X^5 - 20X^3 + 5X. The identity T3(cosθ)=cos3θT_3(\cos\theta) = \cos3\theta is exactly cos3θ=4cos3θ3cosθ\cos3\theta = 4\cos^3\theta - 3\cos\theta from Example 3.9.

2. True for n=1,2n = 1, 2. If Tn1T_{n-1}, TnT_n have degrees n1n-1, nn and leading coefficients 2n22^{n-2}, 2n12^{n-1}, then 2XTn2X\,T_n has degree n+1n+1 and leading coefficient 2n2^n, while Tn1T_{n-1} has lower degree: Tn+1T_{n+1} has degree n+1n + 1, leading coefficient 2n2^n. Parity: if Tn1T_{n-1} has the parity of n1n - 1 and TnT_n that of nn, then 2XTn2X\,T_n and Tn1T_{n-1} both have the parity of n+1n + 1, hence so does Tn+1T_{n+1}.

3. If P(cosθ)=cosnθP(\cos\theta) = \cos n\theta for all θ\theta, then PP and TnT_n agree at every point of [1,1]\intcc{-1}1 — an infinite set — so PTnP - T_n has infinitely many roots and is the zero polynomial (Corollary 8.8).

4. For x=cosθx = \cos\theta: Tm(Tn(cosθ))=Tm(cosnθ)=cos(mnθ)=Tmn(cosθ)T_m(T_n(\cos\theta)) = T_m(\cos n\theta) = \cos(mn\theta) = T_{mn}(\cos\theta), and 2TmTn(cosθ)=2cosmθcosnθ=cos(m+n)θ+cosmnθ2T_mT_n(\cos\theta) = 2\cos m\theta\cos n\theta = \cos(m+n)\theta + \cos\abs{m - n}\theta. Both identities hold on [1,1]\intcc{-1}1, hence as polynomial identities by question 3’s argument.

5. The xkx_k are nn distinct simple roots and the leading coefficient is 2n12^{n-1}:

Tn=2n1k=0n1(Xcos(2k+1)π2n).T_n = 2^{n-1}\prod_{k=0}^{n-1} \Bigl(X - \cos\frac{(2k+1)\pi}{2n}\Bigr) .

Interlacing: the angles 0<π2n<πn<3π2n<2πn<<π0 < \frac{\pi}{2n} < \frac\pi n < \frac{3\pi}{2n} < \frac{2\pi}n < \dots < \pi alternate between the yy-angles kπn\frac{k\pi}n and the xx-angles (2k+1)π2n\frac{(2k+1)\pi}{2n}; since cos\cos is strictly decreasing on [0,π]\intcc0\pi, the values interlace in the reverse order: yn<xn1<yn1<<x0<y0y_n < x_{n-1} < y_{n-1} < \dots < x_0 < y_0. Between two consecutive extrema sits exactly one root, as a picture of cosnθ\cos n\theta suggests.

6. Induction with 2coshacoshb=cosh(a+b)+cosh(ab)2\cosh a\cosh b = \cosh(a + b) + \cosh(a - b) (Proposition 4.18): Tn+1(cosht)=2coshtcoshntcosh(n1)t=cosh(n+1)tT_{n+1}(\cosh t) = 2\cosh t\cosh nt - \cosh(n-1)t = \cosh(n+1)t. For x1x \geq 1, write x=coshtx = \cosh t with t0t \geq 0; then et=x+x21\eu^t = x + \sqrt{x^2 - 1} and et=xx21\eu^{-t} = x - \sqrt{x^2 - 1}, so

Tn(x)=cosh(nt)=(x+x21)n+(xx21)n2.T_n(x) = \cosh(nt) = \frac{(x + \sqrt{x^2-1})^n + (x - \sqrt{x^2-1})^n}2 .

For x>1x > 1 the first term exceeds 12(1)n\frac12(1)^n strictly and grows geometrically: Tn(x)>1T_n(x) > 1.

7. De Moivre: cosnθ=((cosθ+isinθ)n)=2jn(n2j)cosn2jθ(isinθ)2j\cos n\theta = \Re\bigl((\cos\theta + \iu\sin\theta)^n\bigr) = \sum_{2j \leq n}\binom n{2j} \cos^{n-2j}\theta\,(\iu\sin\theta)^{2j}, and (isinθ)2j=(sin2θ)j=(cos2θ1)j(\iu\sin\theta)^{2j} = (-\sin^2\theta)^j = (\cos^2\theta - 1)^j. Substituting x=cosθx = \cos\theta and invoking question 3:

Tn(x)=02jn(n2j)xn2j(x21)j.T_n(x) = \sum_{0\leq 2j\leq n}\binom n{2j}x^{n-2j}(x^2 - 1)^j .

For n=3n = 3: (30)x3+(32)x(x21)=x3+3x33x=4x33x\binom30 x^3 + \binom32 x(x^2 - 1) = x^3 + 3x^3 - 3x = 4x^3 - 3x, as in question 1.

8. Tn(1)=cos(n0)=1T_n(1) = \cos(n\cdot0) = 1; Tn(1)=cos(nπ)=(1)nT_n(-1) = \cos(n\pi) = (-1)^n; Tn(0)=cosnπ2T_n(0) = \cos\frac{n\pi}2, which is 00 for odd nn and (1)n/2(-1)^{n/2} for even nn.

9. Induction for Un(cosθ)=sin(n+1)θsinθU_n(\cos\theta) = \frac{\sin(n+1)\theta}{\sin\theta}: true for U0=1U_0 = 1 and U1=2XU_1 = 2X (sin2θ=2sinθcosθ\sin2\theta = 2\sin\theta\cos\theta); the step is the sum-to-product identity sin(n+2)θ=2cosθsin(n+1)θsinnθ\sin(n+2)\theta = 2\cos\theta\, \sin(n+1)\theta - \sin n\theta. Now differentiate Tn(cosθ)=cosnθT_n(\cos\theta) = \cos n\theta in θ\theta: sinθTn(cosθ)=nsinnθ-\sin\theta\,T_n'(\cos\theta) = -n\sin n\theta, so for θπZ\theta \notin \pi\Z:

Tn(cosθ)=nsinnθsinθ=nUn1(cosθ),T_n'(\cos\theta) = n\,\frac{\sin n\theta}{\sin\theta} = n\,U_{n-1}(\cos\theta) ,

and the polynomials TnT_n' and nUn1nU_{n-1}, agreeing on (1,1)\intoo{-1}1, are equal.

10. sin(n+1)θ=sinnθcosθ+cosnθsinθsinnθ+sinθ\abs{\sin(n+1)\theta} = \abs{\sin n\theta\cos\theta + \cos n\theta\sin\theta} \leq \abs{\sin n\theta} + \abs{\sin\theta}, and induction gives sinnθnsinθ\abs{\sin n\theta} \leq n\abs{\sin\theta}. Hence Un1n\abs{U_{n-1}} \leq n on (1,1)\intoo{-1}1 and Tn=nUn1n2\abs{T_n'} = n\abs{U_{n-1}} \leq n^2 there; at ±1\pm1 the bound extends by taking limits (or directly: Un1(1)=nU_{n-1}(1) = n from the recurrence, Un(1)=n+1U_n(1) = n + 1 by induction, and parity gives Un1(1)=(1)n1nU_{n-1}(-1) = (-1)^{n-1}n). Thus Tn(1)=n2T_n'(1) = n^2 and Tn(1)=(1)n1n2T_n'(-1) = (-1)^{n-1}n^2: the bound n2n^2 is attained at the endpoints.

11. Differentiate sinθTn(cosθ)=nsinnθ\sin\theta\,T_n'(\cos\theta) = n\sin n\theta (question 9) with respect to θ\theta:

cosθTn(cosθ)sin2θTn(cosθ)=n2cosnθ=n2Tn(cosθ).\cos\theta\,T_n'(\cos\theta) - \sin^2\theta\,T_n''(\cos\theta) = n^2\cos n\theta = n^2\,T_n(\cos\theta) .

With x=cosθx = \cos\theta and sin2θ=1x2\sin^2\theta = 1 - x^2: xTn(1x2)Tn=n2Tnx\,T_n' - (1 - x^2)T_n'' = n^2T_n on [1,1]\intcc{-1}1, hence everywhere: (1x2)yxy+n2y=0(1 - x^2)y'' - xy' + n^2y = 0 for y=Tny = T_n. Check for T2=2x21T_2 = 2x^2 - 1: (1x2)(4)x(4x)+4(2x21)=44x24x2+8x24=0(1 - x^2)(4) - x(4x) + 4(2x^2 - 1) = 4 - 4x^2 - 4x^2 + 8x^2 - 4 = 0.

12. T~n\widetilde T_n is monic (question 2) and T~n=21nTn21n\abs{\widetilde T_n} = 2^{1-n}\abs{T_n} \leq 2^{1-n} on [1,1]\intcc{-1}1, with T~n(yk)=(1)k21n\widetilde T_n(y_k) = (-1)^k2^{1-n} at the n+1n + 1 points yky_k (Exercise 8.10): the norm is exactly 21n2^{1-n}, attained with alternating signs.

13. T~n\widetilde T_n and PP are both monic of degree nn, so the leading terms cancel: degDn1\deg D \leq n - 1. At yky_k: D(yk)=(1)k21nP(yk)D(y_k) = (-1)^k2^{1-n} - P(y_k), and P(yk)P<21n\abs{P(y_k)} \leq \norm P_\infty < 2^{1-n} forces the sign of D(yk)D(y_k) to be that of (1)k21n(-1)^k2^{1-n}, strictly.

14. DD changes sign between yk+1y_{k+1} and yky_k for each k=0,,n1k = 0, \dots, n-1: by the intermediate value property, DD has a root in each of these nn pairwise disjoint open intervals — nn distinct roots for a nonzero polynomial of degree n1\leq n - 1, impossible. And D=0D = 0 is impossible too (the norms differ). Contradiction: no monic PP of degree nn has P<21n\norm P_\infty < 2^{1-n}, which is Chebyshev’s theorem.

15. Now P(yk)21n\abs{P(y_k)} \leq 2^{1-n} only, so (1)kD(yk)=21n(1)kP(yk)21nP(yk)0(-1)^k D(y_k) = 2^{1-n} - (-1)^kP(y_k) \geq 2^{1-n} - \abs{P(y_k)} \geq 0. Suppose D(yk)=0D(y_k) = 0 at an interior yky_k (0<k<n0 < k < n): then P(yk)=(1)k21nP(y_k) = (-1)^k2^{1-n}, so P\abs P attains its supremum 21n2^{1-n} at the interior point yky_k, whence P(yk)=0P'(y_k) = 0 (interior extremum); and Tn(yk)=nUn1(yk)=0T_n'(y_k) = nU_{n-1}(y_k) = 0 since sin(nkπn)=0\sin(n\cdot\frac{k\pi}n) = 0 — so T~n(yk)=0\widetilde T_n'(y_k) = 0 too, and D(yk)=0D'(y_k) = 0: yky_k is a root of DD of multiplicity at least 22.

16. Count roots of DD with multiplicity. Let zz be the number of interior points yky_k with D(yk)=0D(y_k) = 0 (each a double root, by question 15) and e{0,1,2}e \in \{0, 1, 2\} the number of endpoints (y0y_0 or yny_n) with D=0D = 0 (each a simple root at least). A gap (yk+1,yk)(y_{k+1}, y_k) whose two endpoints both have D0D \neq 0 carries strictly alternating signs, hence an interior root. Each vanishing interior point spoils at most its two adjacent gaps, each vanishing endpoint at most one gap: at least n2zen - 2z - e gaps still contribute one root each, all distinct from the yy-roots. Total: at least (n2ze)+2z+e=n(n - 2z - e) + 2z + e = n roots with multiplicity, for a polynomial of degree n1\leq n - 1: so D=0D = 0 and P=T~nP = \widetilde T_n. The minimizer is unique.

17. The affine map tx=a+b2+ba2tt \mapsto x = \frac{a+b}2 + \frac{b-a}2\,t is a bijection [1,1][a,b]\intcc{-1}1 \to \intcc ab. If PP is monic of degree nn, then Q(t)=P(x(t))Q(t) = P(x(t)) is a polynomial in tt with leading coefficient (ba2)n\bigl(\frac{b-a}2\bigr)^n, and sup[a,b]P=sup[1,1]Q\sup_{\intcc ab}\abs P = \sup_{\intcc{-1}1}\abs Q. The monic polynomial Q/(ba2)nQ/\bigl(\frac{b-a}2\bigr)^n has sup-norm 21n\geq 2^{1-n} (questions 13–14), so

sup[a,b]P(ba2)n21n=2(ba4)n,\sup_{\intcc ab}\abs P \geq \Bigl(\frac{b-a}2\Bigr)^n 2^{1-n} = 2\Bigl(\frac{b-a}4\Bigr)^n ,

with equality exactly for P(x)=(ba2)nT~n(t(x))P(x) = \bigl(\frac{b-a}2\bigr)^n \widetilde T_n\bigl(t(x)\bigr) (question 16).

18. T~3=T34=X334X\widetilde T_3 = \frac{T_3}4 = X^3 - \frac34X; T~3=3X234\widetilde T_3{}' = 3X^2 - \frac34 vanishes at ±12\pm\frac12. Values: T~3(1)=14\widetilde T_3(-1) = -\frac14, T~3(12)=14\widetilde T_3(-\tfrac12) = \frac14, T~3(12)=14\widetilde T_3(\tfrac12) = -\frac14, T~3(1)=14\widetilde T_3(1) = \frac14: four alternating extrema of absolute value 14\frac14 — so T~3=14\norm{\widetilde T_3}_\infty = \frac14, and by Chebyshev’s theorem no monic cubic has smaller sup-norm on [1,1]\intcc{-1}1.

19. ω\omega is monic of degree n+1n + 1, so ω2n\norm\omega_\infty \geq 2^{-n} by Chebyshev’s theorem (degree n+1n+1), with equality if and only if ω=T~n+1=2nTn+1\omega = \widetilde T_{n+1} = 2^{-n}T_{n+1} (question 16), i.e. if and only if the nodes are the n+1n + 1 roots of Tn+1T_{n+1}. With Chebyshev nodes the error factor ω\norm\omega_\infty is 2n2^{-n} — the least possible.

20. 5×36=1805 \times 36^\circ = 180^\circ, so T5(c)=cos180=1T_5(c) = \cos180^\circ = -1: 16c520c3+5c+1=016c^5 - 20c^3 + 5c + 1 = 0. Testing x=1x = -1: 16+205+1=0-16 + 20 - 5 + 1 = 0, and expanding confirms

16x520x3+5x+1=(x+1)(4x22x1)2.16x^5 - 20x^3 + 5x + 1 = (x + 1)\bigl(4x^2 - 2x - 1\bigr)^2 .

Since c=cos361c = \cos36^\circ \neq -1, cc is a root of 4x22x14x^2 - 2x - 1, whose roots are 1±54\frac{1 \pm \sqrt5}4; as c>0c > 0,

cos36=1+54.\cos36^\circ = \frac{1 + \sqrt5}4 .

Consistency: cos72=T2(c)=2c21=23+581=514\cos72^\circ = T_2(c) = 2c^2 - 1 = 2\cdot\frac{3 + \sqrt5}8 - 1 = \frac{\sqrt5 - 1}4, the value found in Exercise 3.8.

21. 1.121=0.210.458\sqrt{1.1^2 - 1} = \sqrt{0.21} \approx 0.458, so x+x211.558x + \sqrt{x^2-1} \approx 1.558 and (1.558)1084.5(1.558)^{10} \approx 84.5, while (1.10.458)100.01(1.1 - 0.458)^{10} \approx 0.01: T10(1.1)84.5+0.01242T_{10}(1.1) \approx \frac{84.5 + 0.01}2 \approx 42. A polynomial trapped in [1,1]\intcc{-1}1 on the interval has already grown past 4040 one tenth beyond its edge: boundedness on a segment says nothing an inch outside it.

22. In question 7’s formula for TpT_p, the term j=0j = 0 is XpX^p; every other term carries (p2j)\binom p{2j} with 0<2j<p0 < 2j < p (note 2jp2j \neq p since pp is odd), which is divisible by pp by the first step of the proof of Theorem 6.23. Hence every coefficient of TpXpT_p - X^p is a multiple of pp. Checks: T3X3=3X33X=3(X3X)T_3 - X^3 = 3X^3 - 3X = 3(X^3 - X); T5X5=15X520X3+5X=5(3X54X3+X)T_5 - X^5 = 15X^5 - 20X^3 + 5X = 5(3X^5 - 4X^3 + X).

23. By question 17 with [a,b]=[0,1]\intcc ab = \intcc01 and n=2n = 2: minimal deviation 2(14)2=182\bigl(\frac14\bigr)^2 = \frac18, attained by (12)2T~2(2x1)=14((2x1)212)=x2x+18\bigl(\frac12\bigr)^2\widetilde T_2(2x - 1) = \frac14\bigl((2x-1)^2 - \frac12\bigr) = x^2 - x + \frac18. The monic quadratic closest to zero on [0,1]\intcc01 is x2x+18x^2 - x + \frac18, with sup-norm 18\frac18.

24. (i) Rigidity — a polynomial with more roots than its degree is zero — powered the uniqueness principle (question 3), the transfer of trigonometric identities to polynomial identities (questions 4, 7, 9, 11), and both root-counting arguments of the extremality proof (questions 14, 16). (ii) The trigonometry of Chapter 3 (de Moivre, sum-to-product) and the hyperbolic functions of Chapter 4 supplied every identity behind the family; the substitution x=cosθx = \cos\theta is the bridge. (iii) The divisibility p(p2j)p \mid \binom p{2j} from Chapter 6 turned the coefficient formula into the congruence of question 22.

25. Chebyshev’s theorem converts an optimization over an infinite-dimensional family (all monic polynomials) into finite combinatorics: a competitor better than T~n\widetilde T_n would differ from it by a low-degree polynomial forced to change sign nn times — one more root than its degree allows. The equioscillation pattern is thus not a curiosity but the very certificate of optimality, and the equality case sharpens root-counting with multiplicities. The substitution x=cosθx = \cos\theta deserves the last word: it transports the rigid, discrete world of polynomials into the periodic world of trigonometry, where roots and extrema of TnT_n are simply the regular grid of cosnθ\cos n\theta. The two analysis facts borrowed — the intermediate value property (question 14; proved in Chapter 13) and the vanishing derivative at an interior extremum (question 15; proved in Chapter 14) — are exactly the tools those later chapters will hand back, closing the loop.

Terms defined in this chapter

See all 395 terms in the glossary