Mathematics · Book 2 · Grades 10–12

High School Mathematics

High School Mathematics · Grades 10–12

20Sequences

A sequence is a list of real numbers indexed by the natural numbers. Sequences model discrete evolutions — populations counted year by year, balances of a bank account, successive approximations of a number — and their limits are the first serious encounter with the infinite. This chapter sets up the vocabulary, the principle of induction, and the fundamental convergence theorems.

20.1 Reasoning by induction

Theorem 20.1 (Principle of induction)

Let P(n)P(n) be a statement depending on an integer nn, and let n0Nn_0 \in \N. If

  1. (base case) P(n0)P(n_0) is true, and
  2. (inductive step) for every nn0n \geq n_0, P(n)P(n) implies P(n+1)P(n+1),

then P(n)P(n) is true for every nn0n \geq n_0.

Proof. Suppose, for contradiction, that the set AA of integers nn0n \geq n_0 for which P(n)P(n) is false is nonempty. Then AA has a smallest element mm.1 Since P(n0)P(n_0) is true, m>n0m > n_0, so m1n0m - 1 \geq n_0 and m1Am-1 \notin A, i.e. P(m1)P(m-1) is true. The inductive step applied to n=m1n = m-1 then shows that P(m)P(m) is true, contradicting mAm \in A.

Example 20.2

Let us prove Bernoulli’s inequality: for every real a>0a > 0 and every nNn \in \N,

(1+a)n1+na.(1+a)^n \geq 1 + na.

Base case. For n=0n = 0, both sides equal 11. Inductive step. Suppose (1+a)n1+na(1+a)^n \geq 1+na for some nNn \in \N. Since 1+a>01 + a > 0, multiplying both sides by 1+a1+a preserves the inequality:

(1+a)n+1(1+na)(1+a)=1+(n+1)a+na21+(n+1)a.(1+a)^{n+1} \geq (1+na)(1+a) = 1 + (n+1)a + na^2 \geq 1 + (n+1)a .

By induction, the inequality holds for all nNn \in \N.

Method 20.3 (Writing an induction proof)

Always make the statement P(n)P(n) explicit before starting. A complete proof has three visible parts: the base case, the inductive step (“assume P(n)P(n); we prove P(n+1)P(n+1)”), and the conclusion invoking the principle of induction. The most common error is to prove the inductive step without ever using the hypothesis P(n)P(n): if that happens, either the proof is wrong or induction was not needed.

20.2 Vocabulary of sequences

Definition 20.4 (Sequence)

A sequence is a function u ⁣:NRu \colon \N \to \R (or from {nN:nn0}\{n \in \N : n \geq n_0\} to R\R). The image of nn is written unu_n, and the sequence itself (un)nN(u_n)_{n\in\N} or simply (un)(u_n).

A sequence may be defined explicitly, by a formula un=f(n)u_n = f(n), or by recurrence, by its first term and a relation un+1=f(un)u_{n+1} = f(u_n).

Definition 20.5 (Monotonicity)

A sequence (un)(u_n) is increasing if un+1unu_{n+1} \geq u_n for all nn, decreasing if un+1unu_{n+1} \leq u_n for all nn, and monotonic if it is increasing or decreasing. It is strictly increasing (resp. decreasing) when the inequalities are strict.

Method 20.6 (Studying the monotonicity of a sequence)

Three standard techniques:

  1. study the sign of un+1unu_{n+1} - u_n;
  2. if all terms are positive, compare un+1un\dfrac{u_{n+1}}{u_n} to 11;
  3. if un=f(n)u_n = f(n) with ff defined on [0,+)\intco{0}{+\infty}, use the variations of ff.

Definition 20.7 (Bounded sequence)

A sequence (un)(u_n) is bounded above if there exists MRM \in \R with unMu_n \leq M for all nn; bounded below if there exists mRm \in \R with unmu_n \geq m for all nn; and bounded if both hold.

20.2.1 Arithmetic and geometric sequences

Definition 20.8 (Arithmetic and geometric sequences)

A sequence (un)(u_n) is arithmetic with common difference rr if un+1=un+ru_{n+1} = u_n + r for all nn, and geometric with common ratio qq if un+1=qunu_{n+1} = q\,u_n for all nn.

Proposition 20.9 (Explicit form and sums)

Let nNn \in \N.

  1. If (un)(u_n) is arithmetic with common difference rr, then un=u0+nru_n = u_0 + nr and

    u0+u1++un=(n+1)u0+un2.u_0 + u_1 + \dots + u_n = (n+1)\,\frac{u_0 + u_n}{2}.
  2. If (un)(u_n) is geometric with common ratio q1q \neq 1, then un=u0qnu_n = u_0\, q^n and

    u0+u1++un=u01qn+11q.u_0 + u_1 + \dots + u_n = u_0\,\frac{1 - q^{n+1}}{1 - q}.

Proof. The explicit forms follow by immediate inductions. For the arithmetic sum, write S=u0++unS = u_0 + \dots + u_n and add the same sum written in reverse order: each of the n+1n+1 column sums equals u0+unu_0 + u_n, so 2S=(n+1)(u0+un)2S = (n+1)(u_0+u_n). For the geometric sum, compute SqSS - qS: all terms cancel in pairs except the first and the last, so (1q)S=u0(1qn+1)(1-q)S = u_0(1 - q^{n+1}).

20.3 Limit of a sequence

Definition 20.10 (Convergent sequence)

A sequence (un)(u_n) converges to the real number \ell if every open interval containing \ell contains all the terms unu_n from some index on. We then write limn+un=\lim\limits_{n\to+\infty} u_n = \ell.

Equivalently: for every ε>0\varepsilon > 0, there exists NNN \in \N such that for all nNn \geq N, unε\abs{u_n - \ell} \leq \varepsilon.

Convergence of u_n = 2 + (-1)n/n to = 2: given > 0, all terms from the index N on lie in the band [ - , + ].
Convergence of un=2+(1)nnu_n = 2 + \frac{(-1)^n}{n} to =2\ell = 2: given ε>0\varepsilon > 0, all terms from the index NN on lie in the band [ε,+ε]\intcc{\ell-\varepsilon}{\ell+\varepsilon}.

Definition 20.11 (Divergence to infinity)

The sequence (un)(u_n) tends to ++\infty if for every ARA \in \R, there exists NNN \in \N such that unAu_n \geq A for all nNn \geq N. We write limn+un=+\lim\limits_{n\to+\infty} u_n = +\infty; the definition of limun=\lim u_n = -\infty is analogous. A sequence that does not converge is said to diverge.

Remark 20.12

A sequence can diverge without tending to ±\pm\infty: the sequence un=(1)nu_n = (-1)^n takes only the values 11 and 1-1 and has no limit.

Proposition 20.13 (Uniqueness of the limit)

If (un)(u_n) converges, its limit is unique.

Proof. Suppose unu_n \to \ell and unu_n \to \ell' with \ell \neq \ell', say <\ell < \ell'. Set ε=3>0\varepsilon = \frac{\ell' - \ell}{3} > 0. From some index on, unε\abs{u_n - \ell} \leq \varepsilon and unε\abs{u_n - \ell'} \leq \varepsilon, hence

un+un2ε=23()<,\ell' - \ell \leq \abs{\ell' - u_n} + \abs{u_n - \ell} \leq 2\varepsilon = \tfrac{2}{3}(\ell' - \ell) < \ell' - \ell,

a contradiction.

Proposition 20.14 (Operations on limits)

Let (un)(u_n) and (vn)(v_n) be sequences with limits \ell and \ell' (finite or infinite). Then, whenever the right-hand side is not an indeterminate form,

lim(un+vn)=+,lim(unvn)=,limunvn=.\lim (u_n + v_n) = \ell + \ell', \qquad \lim (u_n v_n) = \ell\,\ell', \qquad \lim \frac{u_n}{v_n} = \frac{\ell}{\ell'}.

The indeterminate forms are (+)+()(+\infty) + (-\infty), 0×0 \times \infty, \frac{\infty}{\infty} and 00\frac{0}{0}.

Proof. We prove the sum rule for finite limits; the other cases are similar and left as exercises. Let ε>0\varepsilon > 0. There exist N1,N2N_1, N_2 such that unε/2\abs{u_n - \ell} \leq \varepsilon/2 for nN1n \geq N_1 and vnε/2\abs{v_n - \ell'} \leq \varepsilon/2 for nN2n \geq N_2. For nmax(N1,N2)n \geq \max(N_1, N_2), the triangle inequality gives

(un+vn)(+)un+vnε.\abs{(u_n + v_n) - (\ell + \ell')} \leq \abs{u_n - \ell} + \abs{v_n - \ell'} \leq \varepsilon. \qedhere

Method 20.15 (Lifting an indeterminate form)

Faced with an indeterminate form, factor out the dominant term. For instance

n2n=n2(11n)n++,2n2+1n2n=2+1/n211/nn+2.n^2 - n = n^2\left(1 - \tfrac{1}{n}\right) \xrightarrow[n\to+\infty]{} +\infty, \qquad \frac{2n^2+1}{n^2 - n} = \frac{2 + 1/n^2}{1 - 1/n} \xrightarrow[n\to+\infty]{} 2 .

20.4 Convergence theorems

Theorem 20.16 (Comparison and squeeze theorems)

Let (un)(u_n), (vn)(v_n), (wn)(w_n) be sequences.

  1. If unvnu_n \leq v_n from some index on and un+u_n \to +\infty, then vn+v_n \to +\infty.
  2. (Squeeze theorem) If unvnwnu_n \leq v_n \leq w_n from some index on and (un)(u_n) and (wn)(w_n) both converge to the same limit \ell, then (vn)(v_n) converges to \ell.

Proof. 1. Let ARA \in \R. Since un+u_n \to +\infty, there is NN with unAu_n \geq A for nNn \geq N; enlarging NN if needed, vnunAv_n \geq u_n \geq A for nNn \geq N.

2. Let ε>0\varepsilon > 0. From some index on, both εun\ell - \varepsilon \leq u_n and wn+εw_n \leq \ell + \varepsilon hold, hence εunvnwn+ε\ell - \varepsilon \leq u_n \leq v_n \leq w_n \leq \ell + \varepsilon, that is vnε\abs{v_n - \ell} \leq \varepsilon.

Example 20.17

For all n1n \geq 1, 1n(1)nn1n-\frac{1}{n} \leq \frac{(-1)^n}{n} \leq \frac{1}{n}, and both bounds tend to 00; hence (1)nn0\frac{(-1)^n}{n} \to 0.

Theorem 20.18 (Monotone convergence theorem)

An increasing sequence that is bounded above converges. A decreasing sequence that is bounded below converges. An increasing sequence that is not bounded above tends to ++\infty.

Partial proof. We prove the third statement. Let (un)(u_n) be increasing and not bounded above, and let ARA \in \R. Since AA is not an upper bound, there exists NN with uNAu_N \geq A; by monotonicity, unuNAu_n \geq u_N \geq A for all nNn \geq N. Hence un+u_n \to +\infty.

The two convergence statements rely on the least upper bound property of R\R; they are admitted at this level (and proved in the first year of university).

Remark 20.19

The theorem guarantees the existence of the limit but does not give its value. An increasing sequence bounded above by MM converges to some M\ell \leq M, not necessarily to MM.

Theorem 20.20 (Limit of geometric sequences)

Let qRq \in \R.

  1. If q>1q > 1, then qn+q^n \to +\infty.
  2. If q=1q = 1, then qn1q^n \to 1.
  3. If q<1\abs{q} < 1, then qn0q^n \to 0.
  4. If q1q \leq -1, then (qn)(q^n) diverges and has no limit.

Proof. 1. Write q=1+aq = 1 + a with a>0a > 0. Bernoulli’s inequality (Example 20.2) gives qn1+na+q^n \geq 1 + na \to +\infty, and we conclude by comparison (Theorem 20.16).

2. Immediate.

3. If q=0q = 0 the claim is clear. Otherwise q<1\abs{q} < 1 gives 1/q>11/\abs{q} > 1, so (1/q)n+(1/\abs{q})^n \to +\infty by point 1, hence qn0\abs{q}^n \to 0, and qnqnqn-\abs{q}^n \leq q^n \leq \abs{q}^n allows us to conclude by the squeeze theorem.

4. For q1q \leq -1, (q2n)(q^{2n}) takes values 1\geq 1 while (q2n+1)(q^{2n+1}) takes values 1\leq -1: no single limit can attract both subsequences.

The three behaviours of (qn): divergence to +∈fty for q > 1 (red), convergence to 0 for q < 1 (blue), and damped oscillation — still convergence to 0 — for -1 < q < 0 (orange).
The three behaviours of (qn)(q^n): divergence to ++\infty for q>1q > 1 (red), convergence to 00 for q<1\abs q < 1 (blue), and damped oscillation — still convergence to 00 — for 1<q<0-1 < q < 0 (orange).

Method 20.21 (Recurrent sequences un+1=f(un)u_{n+1} = f(u_n))

To study a sequence defined by un+1=f(un)u_{n+1} = f(u_n):

  1. prove by induction that (un)(u_n) stays in an interval II on which ff is well behaved (and, often, that (un)(u_n) is monotonic);
  2. deduce convergence from the monotone convergence theorem;
  3. pass to the limit in the relation un+1=f(un)u_{n+1} = f(u_n): if ff is continuous and unIu_n \to \ell \in I, then \ell satisfies f()=f(\ell) = \ell (see Chapter 21); solve this equation and select the right root.
Staircase construction for u_n+1 = √u_n + 2, u_0 = 0 (): each vertical step reads f(u_n) on the curve, each horizontal step carries it back through y = x. The sequence climbs to the fixed point = 2, where the curve meets the line.
Staircase construction for un+1=un+2u_{n+1} = \sqrt{u_n + 2}, u0=0u_0 = 0 (Exercise 20.6): each vertical step reads f(un)f(u_n) on the curve, each horizontal step carries it back through y=xy = x. The sequence climbs to the fixed point =2\ell = 2, where the curve meets the line.

Example 20.22

Let u0=2u_0 = 2 and un+1=12(un+2un)u_{n+1} = \frac{1}{2}\left(u_n + \frac{2}{u_n}\right). One checks by induction that un2u_n \geq \sqrt{2} for all nn (the inequality 12(x+2/x)2\frac{1}{2}(x + 2/x) \geq \sqrt{2} for x>0x>0 is equivalent to (x2)20(x - \sqrt2)^2 \geq 0), then that (un)(u_n) is decreasing, since

un+1un=2un22un0.u_{n+1}-u_n=\frac{2-u_n^2}{2u_n}\leq 0 .

Decreasing and bounded below, (un)(u_n) converges to some 2\ell \geq \sqrt{2}, which must satisfy =12(+2/)\ell = \frac{1}{2}(\ell + 2/\ell), i.e. 2=2\ell^2 = 2. Hence un2u_n \to \sqrt{2}. This is Heron’s algorithm, already used by the Babylonians; its convergence is extremely fast (u3u_3 already gives 2\sqrt 2 to eight decimal places).

20.5 Exercises

Exercise 20.1

Prove by induction that for all nNn \in \N,

12+22++n2=n(n+1)(2n+1)6.1^2 + 2^2 + \dots + n^2 = \frac{n(n+1)(2n+1)}{6}.
Solution

Solution of Exercise 20.1.

Let P(n)P(n) be the statement k=1nk2=n(n+1)(2n+1)6\sum_{k=1}^{n} k^2 = \frac{n(n+1)(2n+1)}{6}. Base case: for n=0n = 0 both sides are 00 (empty sum). Inductive step: assume P(n)P(n). Then

k=1n+1k2=n(n+1)(2n+1)6+(n+1)2=(n+1)(n(2n+1)+6(n+1))6=(n+1)(2n2+7n+6)6.\sum_{k=1}^{n+1} k^2 = \frac{n(n+1)(2n+1)}{6} + (n+1)^2 = \frac{(n+1)\bigl(n(2n+1) + 6(n+1)\bigr)}{6} = \frac{(n+1)(2n^2 + 7n + 6)}{6}.

Since 2n2+7n+6=(n+2)(2n+3)2n^2 + 7n + 6 = (n+2)(2n+3), this is (n+1)(n+2)(2(n+1)+1)6\frac{(n+1)(n+2)(2(n+1)+1)}{6}, which is P(n+1)P(n+1). By induction, P(n)P(n) holds for all nn.

Exercise 20.2

Study the monotonicity of the sequences defined for n1n \geq 1 by

an=n+1n,bn=2nn,cn=n210n.a_n = \frac{n+1}{n}, \qquad b_n = \frac{2^n}{n}, \qquad c_n = n^2 - 10n .
Solution

Solution of Exercise 20.2.

an+1an=n+2n+1n+1n=n(n+2)(n+1)2n(n+1)=1n(n+1)<0a_{n+1} - a_n = \frac{n+2}{n+1} - \frac{n+1}{n} = \frac{n(n+2) - (n+1)^2}{n(n+1)} = \frac{-1}{n(n+1)} < 0: (an)(a_n) is strictly decreasing.

(bn)(b_n) has positive terms and bn+1bn=2n+1n+1n2n=2nn+11    2nn+1    n1\frac{b_{n+1}}{b_n} = \frac{2^{n+1}}{n+1}\cdot\frac{n}{2^n} = \frac{2n}{n+1} \geq 1 \iff 2n \geq n+1 \iff n \geq 1: (bn)(b_n) is increasing (strictly for n2n \geq 2).

cn+1cn=(n+1)210(n+1)n2+10n=2n9c_{n+1} - c_n = (n+1)^2 - 10(n+1) - n^2 + 10n = 2n - 9, which is negative for n4n \leq 4 and positive for n5n \geq 5: (cn)(c_n) decreases up to c5=25c_5 = -25, its minimum, then increases. It is not monotonic.

Exercise 20.3

Compute the limits of the sequences with general terms

un=3n2n+12n2+5,vn=n+1n,wn=2n3n3n+1.u_n = \frac{3n^2 - n + 1}{2n^2 + 5}, \qquad v_n = \sqrt{n+1} - \sqrt{n}, \qquad w_n = \frac{2^n - 3^n}{3^n + 1}.
Solution

Solution of Exercise 20.3.

Factor dominant terms:

un=n2(31/n+1/n2)n2(2+5/n2)n+32.u_n = \frac{n^2(3 - 1/n + 1/n^2)}{n^2(2 + 5/n^2)} \xrightarrow[n\to+\infty]{} \frac{3}{2}.

Multiply by the conjugate:

vn=(n+1)nn+1+n=1n+1+nn+0.v_n = \frac{(n+1) - n}{\sqrt{n+1} + \sqrt{n}} = \frac{1}{\sqrt{n+1}+\sqrt{n}} \xrightarrow[n\to+\infty]{} 0.

Divide numerator and denominator by 3n3^n:

wn=(2/3)n11+(1/3)nn+011+0=1,w_n = \frac{(2/3)^n - 1}{1 + (1/3)^n} \xrightarrow[n\to+\infty]{} \frac{0-1}{1+0} = -1,

using limqn=0\lim q^n = 0 for q<1\abs{q} < 1.

Exercise 20.4

Let (un)(u_n) be the arithmetic sequence with u0=5u_0 = 5 and common difference r=3r = 3, and (vn)(v_n) the geometric sequence with v0=8v_0 = 8 and common ratio q=12q = \frac{1}{2}. Compute unu_n, vnv_n, k=0nuk\sum_{k=0}^{n} u_k and k=0nvk\sum_{k=0}^{n} v_k, and the limits of all four expressions as n+n \to +\infty.

Solution

Solution of Exercise 20.4.

un=5+3n+u_n = 5 + 3n \to +\infty and vn=8(1/2)n=23n0v_n = 8 \cdot (1/2)^n = 2^{3-n} \to 0. The sums are

k=0nuk=(n+1)5+(5+3n)2=(n+1)(10+3n)2n++,\sum_{k=0}^{n} u_k = (n+1)\,\frac{5 + (5+3n)}{2} = \frac{(n+1)(10+3n)}{2} \xrightarrow[n\to+\infty]{} +\infty,
k=0nvk=81(1/2)n+111/2=16(1(12)n+1)n+16.\sum_{k=0}^{n} v_k = 8\,\frac{1 - (1/2)^{n+1}}{1 - 1/2} = 16\left(1 - \left(\tfrac{1}{2}\right)^{n+1}\right) \xrightarrow[n\to+\infty]{} 16 .

Exercise 20.5 ★★

Using the squeeze theorem, compute

limn+n+cosnn+1andlimn+n!nn,\lim_{n\to+\infty} \frac{n + \cos n}{n + 1} \qquad\text{and}\qquad \lim_{n\to+\infty} \frac{n!}{n^n},

where n!=1×2××nn! = 1 \times 2 \times \dots \times n. For the second limit, bound n!nn\frac{n!}{n^n} by a term of a geometric sequence.

Solution

Solution of Exercise 20.5.

Since 1cosn1-1 \leq \cos n \leq 1,

n1n+1n+cosnn+11,\frac{n-1}{n+1} \leq \frac{n + \cos n}{n+1} \leq 1,

and n1n+11\frac{n-1}{n+1} \to 1, so the limit is 11 by the squeeze theorem.

For the second limit, write

0n!nn=1n2nnn1n,0 \leq \frac{n!}{n^n} = \frac{1}{n}\cdot\frac{2}{n}\cdots\frac{n}{n} \leq \frac{1}{n},

because every factor kn\frac{k}{n} with 2kn2 \leq k \leq n is at most 11. Since 1n0\frac1n \to 0, the squeeze theorem gives n!nn0\frac{n!}{n^n} \to 0. (The suggested geometric bound also works: each factor with kn/2k \leq n/2 is at most 12\frac12, giving the stronger bound (1/2)n/2(1/2)^{\floor{n/2}}.)

Exercise 20.6 ★★

Let u0=0u_0 = 0 and un+1=un+2u_{n+1} = \sqrt{u_n + 2} for all nNn \in \N.

  1. Prove by induction that 0un20 \leq u_n \leq 2 for all nn.
  2. Show that (un)(u_n) is increasing.
  3. Deduce that (un)(u_n) converges and determine its limit.
Solution

Solution of Exercise 20.6.

1. u0=0[0,2]u_0 = 0 \in \intcc{0}{2}. If 0un20 \leq u_n \leq 2, then 2un+242 \leq u_n + 2 \leq 4, so 2un+12\sqrt{2} \leq u_{n+1} \leq 2; in particular 0un+120 \leq u_{n+1} \leq 2. By induction the property holds for all nn.

2. un+1un=un+2unu_{n+1} - u_n = \sqrt{u_n + 2} - u_n. For x[0,2]x \in \intcc{0}{2}, x+2x    x+2x2    (2x)(x+1)0\sqrt{x+2} \geq x \iff x + 2 \geq x^2 \iff (2-x)(x+1) \geq 0, which is true. Hence (un)(u_n) is increasing.

3. Increasing and bounded above by 22, (un)(u_n) converges to some [0,2]\ell \in \intcc{0}{2}. Passing to the limit in un+1=un+2u_{n+1} = \sqrt{u_n + 2} (the map xx+2x \mapsto \sqrt{x+2} is continuous) gives =+2\ell = \sqrt{\ell + 2}, so 22=0\ell^2 - \ell - 2 = 0, i.e. {1,2}\ell \in \{-1, 2\}. Since 0\ell \geq 0, limun=2\lim u_n = 2.

Exercise 20.7 ★★

A patient takes a dose of 11 unit of a drug every morning. During each 24-hour period, the body eliminates 40%40\% of the drug present. Let unu_n be the quantity of drug in the body just after the dose on day nn, so that u0=1u_0 = 1.

  1. Justify that un+1=0.6un+1u_{n+1} = 0.6\,u_n + 1.
  2. Let vn=un2.5v_n = u_n - 2.5. Show that (vn)(v_n) is geometric and deduce an explicit formula for unu_n.
  3. Determine the long-term quantity of drug in the body.
Solution

Solution of Exercise 20.7.

1. Between two doses, 40%40\% of the drug is eliminated, so the quantity unu_n becomes 0.6un0.6\,u_n; the next dose adds 11 unit: un+1=0.6un+1u_{n+1} = 0.6\,u_n + 1.

2. vn+1=un+12.5=0.6un+12.5=0.6(un2.5)=0.6vnv_{n+1} = u_{n+1} - 2.5 = 0.6\,u_n + 1 - 2.5 = 0.6(u_n - 2.5) = 0.6\,v_n: (vn)(v_n) is geometric with ratio 0.60.6 and first term v0=12.5=1.5v_0 = 1 - 2.5 = -1.5. Hence vn=1.5×0.6nv_n = -1.5 \times 0.6^n and

un=2.51.5×0.6n.u_n = 2.5 - 1.5 \times 0.6^n .

3. Since 0.6n00.6^n \to 0, un2.5u_n \to 2.5: the quantity of drug stabilizes at 2.52.5 units.

Exercise 20.8 ★★

Let (un)(u_n) be defined by u0=3u_0 = 3 and un+1=4un1un+2u_{n+1} = \frac{4u_n - 1}{u_n + 2}.

  1. Show by induction that un>1u_n > 1 for all nNn \in \N.
  2. Show that vn=1un1v_n = \dfrac{1}{u_n - 1} defines an arithmetic sequence.
  3. Deduce explicit formulas for vnv_n and unu_n, and the limit of (un)(u_n).
Solution

Solution of Exercise 20.8.

1. u0=3>1u_0 = 3 > 1. If un>1u_n > 1, then un+2>0u_n + 2 > 0 and

un+11=4un1un2un+2=3(un1)un+2>0.u_{n+1} - 1 = \frac{4u_n - 1 - u_n - 2}{u_n + 2} = \frac{3(u_n - 1)}{u_n + 2} > 0 .

By induction, un>1u_n > 1 for all nn (and in particular un+20u_n + 2 \neq 0, so the sequence is well defined).

2. Using the identity above,

vn+1=1un+11=un+23(un1)=(un1)+33(un1)=13+vn.v_{n+1} = \frac{1}{u_{n+1} - 1} = \frac{u_n + 2}{3(u_n - 1)} = \frac{(u_n - 1) + 3}{3(u_n - 1)} = \frac{1}{3} + v_n .

So (vn)(v_n) is arithmetic with common difference 13\frac13 and v0=1u01=12v_0 = \frac{1}{u_0 - 1} = \frac12.

3. vn=12+n3v_n = \frac12 + \frac{n}{3}, hence un=1+1vn=1+63+2nu_n = 1 + \frac{1}{v_n} = 1 + \frac{6}{3 + 2n}. Since vn+v_n \to +\infty, un1u_n \to 1.

Exercise 20.9 ★★★

For n1n \geq 1, let Hn=1+12+13++1nH_n = 1 + \frac{1}{2} + \frac{1}{3} + \dots + \frac{1}{n}.

  1. Show that for all n1n \geq 1, H2nHn12H_{2n} - H_n \geq \frac{1}{2}.
  2. Deduce that H2k1+k2H_{2^k} \geq 1 + \frac{k}{2} for all kNk \in \N, and conclude that Hn+H_n \to +\infty.
Solution

Solution of Exercise 20.9.

1. H2nHn=k=n+12n1kH_{2n} - H_n = \sum_{k=n+1}^{2n} \frac{1}{k} is a sum of nn terms, each at least 12n\frac{1}{2n}; hence H2nHnn12n=12H_{2n} - H_n \geq n \cdot \frac{1}{2n} = \frac12.

2. By induction on kk: H20=H1=11H_{2^0} = H_1 = 1 \geq 1. If H2k1+k2H_{2^k} \geq 1 + \frac{k}{2}, then applying point 1 with n=2kn = 2^k,

H2k+1H2k+121+k+12.H_{2^{k+1}} \geq H_{2^k} + \frac12 \geq 1 + \frac{k+1}{2}.

The sequence (Hn)(H_n) is increasing (each step adds 1n+1>0\frac{1}{n+1} > 0) and the subsequence H2kH_{2^k} is unbounded, so (Hn)(H_n) is not bounded above. Increasing and unbounded, it tends to ++\infty (Theorem 20.18).

Exercise 20.10 ★★★

(Adjacent sequences.) Two sequences (an)(a_n) and (bn)(b_n) are adjacent if (an)(a_n) is increasing, (bn)(b_n) is decreasing, and bnan0b_n - a_n \to 0.

  1. Show that for all nn, anbna_n \leq b_n. (Hint: study the monotonicity of (bnan)(b_n - a_n).)
  2. Show that adjacent sequences both converge, to the same limit.
  3. Application: show that the sequences an=k=0n1k!a_n = \sum_{k=0}^{n} \frac{1}{k!} and bn=an+1nn!b_n = a_n + \frac{1}{n \cdot n!} (n1n \geq 1) are adjacent. (Their common limit is the number e\eu, studied in Chapter 23.)
Solution

Solution of Exercise 20.10.

1. The sequence dn=bnand_n = b_n - a_n satisfies dn+1dn=(bn+1bn)(an+1an)0d_{n+1} - d_n = (b_{n+1} - b_n) - (a_{n+1} - a_n) \leq 0, so (dn)(d_n) is decreasing; since dn0d_n \to 0, we get dn0d_n \geq 0 for all nn (a decreasing sequence with a negative term would stay below it forever, preventing the limit 00). Hence anbna_n \leq b_n.

2. From anbnb0a_n \leq b_n \leq b_0, the increasing sequence (an)(a_n) is bounded above, so it converges to some \ell. Similarly (bn)(b_n), decreasing and bounded below by a0a_0, converges to some \ell'. Then =lim(bnan)=0\ell' - \ell = \lim (b_n - a_n) = 0, so =\ell = \ell'.

3. (an)(a_n) is (strictly) increasing since an+1an=1(n+1)!>0a_{n+1} - a_n = \frac{1}{(n+1)!} > 0. For (bn)(b_n),

bn+1bn=1(n+1)!+1(n+1)(n+1)!1nn!=n(n+1)+n(n+1)2n(n+1)(n+1)!=1n(n+1)(n+1)!<0,b_{n+1} - b_n = \frac{1}{(n+1)!} + \frac{1}{(n+1)(n+1)!} - \frac{1}{n\,n!} = \frac{n(n+1) + n - (n+1)^2}{n(n+1)(n+1)!} = \frac{-1}{n(n+1)(n+1)!} < 0 ,

so (bn)(b_n) is decreasing. Finally bnan=1nn!0b_n - a_n = \frac{1}{n\,n!} \to 0. The two sequences are adjacent, hence converge to a common limit.

20.6 Problem: Heron’s sequence, judged at last

Problem 20.1

Weekend problem — induction certifies, monotone convergence sentences, and the two-thousand-year-old recipe for 2\sqrt2 finally gets its proof (with Gauss’s marvellous mean for dessert)

Three times this series has met Heron’s recipe — average the guess with 2/guess2/\text{guess} — and three times it could only observe that the recipe works. This chapter at last owns the instruments of judgment: induction (Theorem 20.1), the monotone convergence theorem (Theorem 20.18), and limits of recurrences. The verdict, and the certified speed, occupy the heart of this problem; around it, induction’s classic traps, the slowest divergence in mathematics, and the fastest convergence Gauss ever found.

Part I — Induction warm-ups.

  1. Prove by induction: 1+3+5++(2n1)=n21 + 3 + 5 + \dots + (2n - 1) = n^2 (the staircase of odd numbers, drawn in the Middle School volume, now certified).
  2. Prove by induction that 2n>n2^n > n for every nNn \in \N.
  3. Prove Bernoulli’s inequality by induction: for x0x \geq 0 and nNn \in \N, (1+x)n1+nx(1 + x)^n \geq 1 + nx.
  4. The classic trap: “all marbles have the same color — true for one marble; and if any nn marbles are always monochrome, then among n+1n + 1 marbles the first nn share a color, the last nn share a color, so all n+1n + 1 do.” Every child knows the conclusion is absurd: find the exact step where the induction breaks.
  5. Prove by induction that 4n14^n - 1 is divisible by 33 for every nNn \in \N.

Part II — The trial of Heron. Let x0=2x_0 = 2 and xn+1=12(xn+2xn)x_{n+1} = \dfrac12\left(x_n + \dfrac{2}{x_n}\right).

  1. Compute x1x_1, x2x_2, x3x_3 as exact fractions (old friends).
  2. Prove the key identity

    xn+122=(xn222xn) ⁣20,x_{n+1}^2 - 2 = \left(\frac{x_n^2 - 2}{2x_n}\right)^{\!2} \geq 0,

    and deduce by induction that xn>0x_n > 0 and xn2>2x_n^2 > 2 for every nn.

  3. Show that (xn)(x_n) is strictly decreasing (compute xn+1xnx_{n+1} - x_n and use question 7).
  4. Invoke the monotone convergence theorem: why does (xn)(x_n) converge to some limit L1L \geq 1?
  5. Identify the limit: pass the recurrence to the limit (Proposition 20.14) and conclude L=2L = \sqrt2. State the historical verdict: after two thousand years of faithful service, Heron’s recipe is proved to converge.
  6. The certified speed: with en=xn2e_n = x_n - \sqrt2, prove

    en+1=en22xn,e_{n+1} = \frac{e_n^2}{2 x_n} ,

    and deduce en+1en222e_{n+1} \leq \frac{e_n^2}{2\sqrt2}: the error is squared at each step — the digit-doubling observed since the Middle School volume, now a theorem.

  7. Confirm numerically: compute e0,e1,e2,e3e_0, e_1, e_2, e_3 (from question 6) and check that each en+1en2\frac{e_{n+1}}{e_n^2} is close to 12xn\frac{1}{2x_n}.

Part III — The slowest divergence.

  1. Exercise 20.9 proved H2k1+k2H_{2^k} \geq 1 + \frac k2 for the harmonic sums. How many terms guarantee Hn>10H_n > 10? (A power of two will do; marvel at its size.)
  2. By contrast, the geometric sums 1+12+14++12n=212n1 + \frac12 + \frac14 + \dots + \frac{1}{2^n} = 2 - \frac{1}{2^n} converge to 22 (Theorem 20.20): the chocolate-bar intuition of the Middle School volume, finally a limit statement. Write out the two-line proof.
  3. Between the two: show that the sums Sn=1+14+19++1n2S_n = 1 + \frac{1}{4} + \frac{1}{9} + \dots + \frac{1}{n^2} converge, by bounding 1k21k(k1)=1k11k\frac{1}{k^2} \leq \frac{1}{k(k-1)} = \frac{1}{k-1} - \frac{1}{k} (for k2k \geq 2), telescoping, and applying monotone convergence. (The limit, π26\frac{\pi^2}{6}, is one of Euler’s miracles, proved in the university volumes.)
  4. State the moral of questions 13–15 in two sentences: what does “the terms tend to 00” decide about the convergence of the sums — and what does it not?

Part IV — Gauss’s arithmetic–geometric mean. Let a0=1a_0 = 1, b0=2b_0 = 2, and

an+1=anbn,bn+1=an+bn2.a_{n+1} = \sqrt{a_n b_n}, \qquad b_{n+1} = \frac{a_n + b_n}{2} .
  1. Compute a1,b1,a2,b2a_1, b_1, a_2, b_2 (five decimals). What do you observe about the speed?
  2. Show that anbna_n \leq b_n for every nn (the arithmetic–geometric inequality, met throughout this series), that (an)(a_n) increases and (bn)(b_n) decreases.
  3. Show that bn+1an+1bnan2b_{n+1} - a_{n+1} \leq \frac{b_n - a_n}{2} (factor bn+1an+1=(bnan)22b_{n+1} - a_{n+1} = \frac{(\sqrt{b_n} - \sqrt{a_n})^2}{2} and compare), and conclude with Exercise 20.10 that the two sequences are adjacent: they share a common limit M(1,2)M(1, 2), the arithmetic–geometric mean.
  4. Compute M(1,2)M(1, 2) to six decimals (how many iterations did you need?). On 30 May 1799, Gauss computed M(1,2)M(1, \sqrt2) to eleven decimals, recognized πM(1,2)\frac{\pi}{M(1,\sqrt2)} as a known integral, and wrote that a “new field of analysis” had opened — it had: elliptic integrals, told in the university volumes. Close with the observed convergence speeds of this problem, slowest to fastest.
Solution

Solution of Problem 20.1.

1. True for n=1n = 1 (1=121 = 1^2). If 1+3++(2n1)=n21 + 3 + \dots + (2n - 1) = n^2, then adding the next odd number: n2+(2n+1)=(n+1)2n^2 + (2n + 1) = (n + 1)^2: heredity. By induction, true for all n1n \geq 1.

2. 20=1>02^0 = 1 > 0. If 2n>n2^n > n, then 2n+1=22n>2nn+12^{n+1} = 2 \cdot 2^n > 2n \geq n + 1 for n1n \geq 1 (and n=0n = 0 checks directly): heredity, done.

3. n=0n = 0: 111 \geq 1. If (1+x)n1+nx(1 + x)^n \geq 1 + nx, multiply by 1+x1>01 + x \geq 1 > 0: (1+x)n+1(1+nx)(1+x)=1+(n+1)x+nx21+(n+1)x(1 + x)^{n+1} \geq (1 + nx)(1 + x) = 1 + (n + 1)x + nx^2 \geq 1 + (n + 1)x.

4. The step from n=1n = 1 to n=2n = 2: among two marbles, “the first nn” and “the last nn” are two disjoint single marbles — no common marble bridges the two groups, so nothing forces their colors to agree. The heredity argument silently requires the two groups to overlap, true only from n2n \geq 2; with the base case n=1n = 1 the chain never starts.

5. 401=0=3×04^0 - 1 = 0 = 3 \times 0. If 4n1=3k4^n - 1 = 3k, then 4n+11=4(4n1)+3=3(4k+1)4^{n+1} - 1 = 4(4^n - 1) + 3 = 3(4k + 1): heredity.

6. x1=32x_1 = \frac32, x2=1712x_2 = \frac{17}{12}, x3=577408x_3 = \frac{577}{408}.

7. xn+122=(xn2+2)28xn24xn2=(xn22)24xn2x_{n+1}^2 - 2 = \frac{(x_n^2 + 2)^2 - 8x_n^2} {4x_n^2} = \frac{(x_n^2 - 2)^2}{4 x_n^2}: a square over a positive, hence 0\geq 0, and >0> 0 whenever xn22x_n^2 \neq 2. Induction: x0=2>0x_0 = 2 > 0 with x02=4>2x_0^2 = 4 > 2; if xn>0x_n > 0 and xn2>2x_n^2 > 2, then xn+1x_{n+1} (an average of positives) is positive and xn+122>0x_{n+1}^2 - 2 > 0.

8. xn+1xn=2xn22xn<0x_{n+1} - x_n = \frac{2 - x_n^2}{2x_n} < 0 by question 7: strictly decreasing.

9. Decreasing and bounded below (by 11, since xn2>2>1x_n^2 > 2 > 1 and xn>0x_n > 0): by the monotone convergence theorem, (xn)(x_n) converges to some L1L \geq 1.

10. Limits respect the algebra: from xn+1=12(xn+2xn)x_{n+1} = \frac12\left(x_n + \frac{2}{x_n}\right) and xnL1>0x_n \to L \geq 1 > 0: L=12(L+2L)L = \frac12\left(L + \frac2L\right), so L2=2L^2 = 2 and, LL being positive, L=2L = \sqrt2. Verdict: convergence proved, limit identified — Heron acquitted with honors.

11. xn+12=xn222xn+22xn=(xn2)22xnx_{n+1} - \sqrt2 = \frac{x_n^2 - 2\sqrt2\,x_n + 2}{2x_n} = \frac{(x_n - \sqrt2)^2}{2x_n}: exactly en+1=en22xne_{n+1} = \frac{e_n^2}{2x_n}, and xn>2x_n > \sqrt2 gives en+1en222e_{n+1} \leq \frac{e_n^2}{2\sqrt2}. Squared error: each step doubles the number of correct decimals, as observed since grade 9.

12. e00.5858e_0 \approx 0.5858, e10.0858e_1 \approx 0.0858, e20.00245e_2 \approx 0.00245, e32.1×106e_3 \approx 2.1 \times 10^{-6}. Ratios e1e020.25=12x0\frac{e_1}{e_0^2} \approx 0.25 = \frac{1}{2x_0}; e2e120.333=12x1\frac{e_2}{e_1^2} \approx 0.333 = \frac{1}{2x_1}; e3e220.35312x2\frac{e_3}{e_2^2} \approx 0.353 \approx \frac{1}{2x_2}: the theorem in action.

13. H2181+9=10H_{2^{18}} \geq 1 + 9 = 10: about 260000260\,000 terms (218=2621442^{18} = 262\,144) merely to pass 1010 — divergence at a crawl (and Hn>100H_n > 100 would need more terms than atoms in any library).

14. Sn=212nS_n = 2 - \frac{1}{2^n} (geometric sum), and 12n0\frac{1}{2^n} \to 0 (Theorem 20.20), so Sn2S_n \to 2: the endlessly bitten chocolate bar tends to, without ever reaching, the whole — now in the official language of limits.

15. For k2k \geq 2: 1k21k(k1)=1k11k\frac{1}{k^2} \leq \frac{1}{k(k-1)} = \frac{1}{k-1} - \frac1k, so Sn1+(11n)<2S_n \leq 1 + \left(1 - \frac1n\right) < 2: increasing and bounded above, hence convergent (monotone convergence). Euler later named the limit: π26\frac{\pi^2}{6}.

16. Terms tending to 00 is necessary for the sums to settle but decides nothing: the harmonic terms 1n0\frac1n \to 0 yet the sums blow up; the terms 1n20\frac{1}{n^2} \to 0 and the sums converge. How fast the terms die is the whole question — the theory of series, built in the university volumes.

17. a1=21.41421a_1 = \sqrt2 \approx 1.41421, b1=1.5b_1 = 1.5; a21.45648a_2 \approx 1.45648, b21.45711b_2 \approx 1.45711: two iterations already agree to three decimals — staggering speed.

18. bn+1an+1=an+bn2anbn=(bnan)220b_{n+1} - a_{n+1} = \frac{a_n + b_n}{2} - \sqrt{a_n b_n} = \frac{(\sqrt{b_n} - \sqrt{a_n})^2}{2} \geq 0: means stay ordered. (an)(a_n) increases: an+1=anbnanan=ana_{n+1} = \sqrt{a_n b_n} \geq \sqrt{a_n \cdot a_n} = a_n; (bn)(b_n) decreases symmetrically.

19. bn+1an+1bnan=(bnan)22(bnan)(bn+an)=bnan2(bn+an)12\frac{b_{n+1} - a_{n+1}}{b_n - a_n} = \frac{(\sqrt{b_n} - \sqrt{a_n})^2} {2(\sqrt{b_n} - \sqrt{a_n})(\sqrt{b_n} + \sqrt{a_n})} = \frac{\sqrt{b_n} - \sqrt{a_n}}{2(\sqrt{b_n} + \sqrt{a_n})} \leq \frac12: the gap at least halves, so bnan0b_n - a_n \to 0; with question 18, the sequences are adjacent and share a limit M(1,2)M(1, 2).

20. Iteration three gives a3b31.456791a_3 \approx b_3 \approx 1.456791: M(1,2)1.456791M(1, 2) \approx 1.456791 in three turns of the crank (the gap roughly squares, like Heron’s). Speed ranking of the problem’s sequences, slowest to fastest: the harmonic sums (glacial divergence), the geometric sums (error halved each step), Heron and the AGM (error squared each step) — and it was the AGM’s unearthly speed that told Gauss he had struck a new vein of analysis.

  1. Every nonempty subset of N\N has a smallest element; this property of N\N is taken as an axiom.